1-Hydroxyphenanthrene

{{Chembox

| ImageFile = 1-Hydroxyphenanthrene.svg

| ImageAlt = Chemical structure of 1-hydroxyphenanthrene

| PIN = Phenanthren-1-ol

| OtherNames = 1-Phenanthrenol
1-Phenanthrol
1-hydroxy-phenanthrene

|Section1={{Chembox Identifiers

| CASNo = 2433-56-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Y1FTF7MUY7

| ChemSpiderID = 88945

| PubChem = 98490

| SMILES = C1=CC=C2C(=C1)C=CC3=C2C=CC=C3O

}}

|Section2={{Chembox Properties

| C = 14 | H = 10 | O = 1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

1-Hydroxyphenanthrene is a phenanthrol and a human metabolite of phenanthrene that can be detected in urine of persons exposed to PAHs.PAH metabolites (1-hydroxyphenanthrene, 4-hydroxyphenanthrene, 9-hydroxyphenanthrene, 1-hydroxypyrene). The MAK Collection for Occupational Health and Safety, Biomonitoring Methods, Vol. 6 ([http://onlinelibrary.wiley.com/doi/10.1002/3527600418.bi0pahmete0006/pdf article])

It can also be used as a marker for PAH pollution measured in marine fish bile.PAH Metabolites in Bile Fluids of Dab (Limanda limanda) and Flounder (Platichthys flesus): Spatial Distribution and Seasonal Changes. Ulrike Kammann, Environmental Science and Pollution Research - International, March 2007, Volume 14, Issue 2, pages 102-108, {{doi|10.1065/espr2006.05.308}}

The model fungus Cunninghamella elegans produces, in the case of the biodegradation of phenanthrene, a glucoside conjugate of 1-hydroxyphenanthrene (phenanthrene 1-O-beta-glucose).{{Cite journal

| last1 = Cerniglia | first1 = C. E.

| last2 = Campbell | first2 = W. L.

| last3 = Freeman | first3 = J. P.

| last4 = Evans | first4 = F. E.

| title = Identification of a novel metabolite in phenanthrene metabolism by the fungus Cunninghamella elegans

| journal = Applied and Environmental Microbiology

| volume = 55

| issue = 9

| pages = 2275–2279

| year = 1989

| pmid = 2802607

| pmc = 203068

| doi = 10.1128/AEM.55.9.2275-2279.1989

| bibcode = 1989ApEnM..55.2275C

}}