1-Nitronaphthalene

{{Chembox

| ImageFile = 1-nitronaphthalene 200.svg

| ImageFile1 = 1-nitronaphthalene.jpg

| ImageSize = 120 px

| ImageAlt =

| PIN = 1-Nitronaphthalene

| OtherNames = α-Nitronaphthalene

| Section1 = {{Chembox Identifiers

| CASNo = 86-57-7

| Beilstein = 1867714

| ChEBI = 34104

| ChEMBL = 165373

| ChemSpiderID = 6588

| DTXSID = DTXSID7020978

| EINECS = 201-684-5

| KEGG = C14040

| PubChem = 6849

| UNNumber = 2538

| UNII = A51NP1DL2T

| StdInChI=1S/C10H7NO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H

| StdInChIKey = RJKGJBPXVHTNJL-UHFFFAOYSA-N

| SMILES = C1=CC=C2C(=C1)C=CC=C2[N+](=O)[O-]

}}

| Section2 = {{Chembox Properties

| C=10|H=7|N=1|O=2

| MolarMass =

| Appearance = pale yellow solid

| Density = 1.332 g/cm³

| MeltingPtC = 52-61

| BoilingPtC = 304

| Solubility = }}

| Section3 = {{Chembox Hazards

| GHSPictograms = {{GHS02}}{{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|228|301|315|319|335|351|411}}

| PPhrases = {{P-phrases|201|202|210|240|241|261|264|270|271|273|280|281|301+310|302+352|304+340|305+351+338|308+313|312|321|330|332+313|337+313|362|370+378|391|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

1-Nitronaphthalene is an organic compound with the formula C₁₀H₇NO₂. It is one of two isomers of nitronaphthalene. A pale yellow, sublimable solid, 1-nitronaphthalene is the main product of the direct nitration of naphthalene. It is an intermediate in the production of naphthylamine, a precursor to dyes.{{Ullmann |doi=10.1002/14356007.a17_411|title=Nitro Compounds, Aromatic|year=2005|last1=Booth|first1=Gerald}} The conversion to the amine is effected by hydrogenation.{{cite journal |doi=10.1038/nchem.1645 |title=Heterogenized Cobalt Oxide Catalysts for Nitroarene Reduction by Pyrolysis of Molecularly Defined Complexes |date=2013 |last1=Westerhaus |first1=Felix A. |last2=Jagadeesh |first2=Rajenahally V. |last3=Wienhöfer |first3=Gerrit |last4=Pohl |first4=Marga-Martina |last5=Radnik |first5=Jörg |last6=Surkus |first6=Annette-Enrica |last7=Rabeah |first7=Jabor |last8=Junge |first8=Kathrin |last9=Junge |first9=Henrik |last10=Nielsen |first10=Martin |last11=Brückner |first11=Angelika |last12=Beller |first12=Matthias |journal=Nature Chemistry |volume=5 |issue=6 |pages=537–543 |pmid=23695637 |bibcode=2013NatCh...5..537W |s2cid=3273484 }}