15α-Hydroxyestradiol

{{Chembox

| ImageFile = 15alpha-hydroxyestradiol.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = Estra-1,3,5(10)-triene-3,15α,17β-triol

| SystematicName = (1S,3S,3aS,3bR,9bS,11aS)-11a-Methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1H-cyclopenta[a]phenanthrene-1,3,7-triol

| OtherNames = 15α-OH-E2; 15α-Hydroxy-17β-estradiol; 3,15α,17β-Trihydroxyestra-1,3,5(10)-triene

| Section1 = {{Chembox Identifiers

| CASNo = 570-30-9

| ChEBI = 87593

| ChemSpiderID = 59792

| InChI = 1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)17(18)15(20)9-16(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17-,18-/m1/s1

| InChIKey = QVQMPLATUBCZMQ-GVLSGGHMSA-N

| PubChem = 66418

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1[C@H](C[C@@H]2O)O)CCC4=C3C=CC(=C4)O

}}

| Section2 = {{Chembox Properties

| C=18 | H=24 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

15α-Hydroxyestradiol (15α-OH-E2) is an endogenous estrogen which occurs during pregnancy.{{cite journal | vauthors = Lisboa BP, Goebelsmann U, Diczfalusy E | title = Isolation of 15-alpha-hydroxyoestradiol from human pregnancy urine | journal = Acta Endocrinol. | volume = 54 | issue = 3 | pages = 467–72 | date = March 1967 | pmid = 6071364 | doi = 10.1530/acta.0.0540467 }}{{cite journal | vauthors = Jirku H, Kadner S, Levitz M | title = Metabolism of 15alpha-hydroxyestradiol in human pregnancy | journal = J. Clin. Endocrinol. Metab. | volume = 35 | issue = 4 | pages = 522–34 | date = October 1972 | pmid = 4559652 | doi = 10.1210/jcem-35-4-522 }}{{cite journal | vauthors = Lee AJ, Kosh JW, Conney AH, Zhu BT | title = Characterization of the NADPH-dependent metabolism of 17beta-estradiol to multiple metabolites by human liver microsomes and selectively expressed human cytochrome P450 3A4 and 3A5 | journal = J. Pharmacol. Exp. Ther. | volume = 298 | issue = 2 | pages = 420–32 | date = August 2001 | doi = 10.1016/S0022-3565(24)29399-X | pmid = 11454902 }} It is structurally related to estriol (16α-hydroxyestradiol) and estetrol (15α-hydroxyestriol or 15α,16α-dihydroxyestradiol).

References

{{Reflist}}

{{Endogenous steroids}}

{{Estrogen receptor modulators}}

{{DEFAULTSORT:Hydroxyestradiol, 15α-}}

Category:Estranes

Category:Estrogens

Category:Hormones of the hypothalamus-pituitary-gonad axis

Category:Hormones of the pregnant female

Category:Hydroxyarenes

Category:Triols

{{Steroid-stub}}