16α-Iodo-E2
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (8R,9S,13S,14S,16R,17R)-16-iodo-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
| image = 16-Iodoestradiol structure.svg
| width = 220
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 7450-34-2
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 67087
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 60437
| UNII =
| KEGG =
| ChEBI =
| ChEMBL = 342892
| C=18 | H=23 | I=1 | O=2
| molecular_weight =
| smiles = C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)I)CCC4=C3C=CC(=C4)O
| StdInChI_Ref =
| StdInChI = 1S/C18H23IO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19)17(18)21/h3,5,8,13-17,20-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = SSYGGPAGDDGXAF-ZXXIGWHRSA-N
| synonyms =
}}
16α-Iodo-E2, or 16α-iodoestradiol, is a synthetic, steroidal, potent estrogen with slight preference for the ERα over the ERβ that is used in scientific research.{{cite journal | vauthors = Manas ES, Unwalla RJ, Xu ZB, Malamas MS, Miller CP, Harris HA, Hsiao C, Akopian T, Hum WT, Malakian K, Wolfrom S, Bapat A, Bhat RA, Stahl ML, Somers WS, Alvarez JC | title = Structure-based design of estrogen receptor-beta selective ligands | journal = J. Am. Chem. Soc. | volume = 126 | issue = 46 | pages = 15106–19 | year = 2004 | pmid = 15548008 | doi = 10.1021/ja047633o }}{{cite journal | vauthors = Chen GG, Vlantis AC, Zeng Q, van Hasselt CA | title = Regulation of cell growth by estrogen signaling and potential targets in thyroid cancer | journal = Curr Cancer Drug Targets | volume = 8 | issue = 5 | pages = 367–77 | year = 2008 | pmid = 18690843 | doi = 10.2174/156800908785133150}} The KD of 16α-iodo-E2 for the ERα is 0.6 nM and for the ERβ is 0.24 nM, a 4-fold difference in affinity, whereas estradiol is considered to have similar affinity for the two receptor subtypes. Unlike the case of the much weaker estriol (16α-hydroxyestradiol), 16α-iodo-E2 is considered to be equipotent with estradiol in terms of estrogenic activity.{{cite journal | vauthors = Hochberg RB, Zielinski JE, Duax WL, Strong P | title = The molecular structure of 16 alpha-iodo-17 beta-estradiol, a high affinity ligand for the estrogen receptor | journal = J. Steroid Biochem. | volume = 25 | issue = 5A | pages = 615–8 | year = 1986 | pmid = 3795941 | doi = 10.1016/0022-4731(86)90002-6}} Radiolabeled [16α-125I]iodo-E2 has been employed in imaging to study the estrogen receptor.{{cite journal | vauthors = Cummins CH | title = Radiolabeled steroidal estrogens in cancer research | journal = Steroids | volume = 58 | issue = 6 | pages = 245–59 | year = 1993 | pmid = 8212070 | doi = 10.1016/0039-128x(93)90069-y| s2cid = 29080385 }}
See also
References
{{reflist|30em}}
{{Estrogen receptor modulators}}
{{steroid-stub}}
{{genito-urinary-drug-stub}}