16β-Hydroxyestrone

{{Chembox

| ImageFile = 16beta-hydroxyestrone.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 3,16β-Dihydroxyestra-1,3,5(10)-trien-17-one

| SystematicName = (2S,3aS,3bR,9bS,11aS)-2,7-Dihydroxy-11a-methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1H-cyclopenta[a]phenanthren-1-one

| OtherNames = 16β-OH-E1

| Section1 = {{Chembox Identifiers

| CASNo = 966-06-3

| ChEBI = 87628

| ChEMBL = 1908079

| ChemSpiderID = 17215934

| InChI = 1S/C18H22O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-16,19-20H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,18+/m1/s1

| InChIKey = WPOCIZJTELRQMF-LFRCEIEQSA-N

| PubChem = 22833517

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@@H](C2=O)O)CCC4=C3C=CC(=C4)O

}}

| Section2 = {{Chembox Properties

| C=18 | H=22 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

16β-Hydroxyestrone (16β-OH-E1) is an endogenous estrogen which serves as a metabolite of estrone as well as a metabolic intermediate in the transformation of estrone into epiestriol (16β-hydroxyestradiol).{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/compound/22833517 | title = 16beta-Hydroxyestrone | publisher = PubChem}} {{cite conference|conference=Hormonal Steroids Biochemistry, Pharmacology, and Therapeutics |last1=Velardo |first1=Joseph Thomas |title=The Actions of Steroid Hormones on Estradiol-17β in Uterine Growth and Enzymorphology |year=1964 |pages=463–490 |doi=10.1016/B978-0-12-395506-7.50065-0}} 16β-Hydroxyestrone has similar estrogenic activity to that of 16α-hydroxyestrone. It is less potent than estradiol or estrone but can produce similar maximal uterotrophy at sufficiently high doses, suggesting a fully estrogenic profile.