18-Hydroxycorticosterone

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{chembox

| Verifiedfields = changed

| verifiedrevid = 477209316

| ImageFile = 18-hydroxycorticosterone.PNG

| ImageSize = 220px

| ImageFile1 = 18-Hydroxycorticosterone-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = 18-Hydroxycorticosterone

| IUPACName = 11β,18,21-Trihydroxypregn-4-ene-3,20-dione

| SystematicName = (1S,3aS,3bS,9aR,9bS,10S,11aR)-10-Hydroxy-1-(hydroxyacetyl)-11a-(hydroxymethyl)-9a-methyl-1,2,3,3a,3b,4,5,8,9,9a,9b,10,11,11a-tetradecahydro-7H-cyclopenta[a]phenanthren-7-one

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16485

| ChemSpiderID = 10748

| InChI = 1/C21H30O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,14-17,19,22-23,25H,2-7,9-11H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1

| InChIKey = HFSXHZZDNDGLQN-ZVIOFETBBO

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H30O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,14-17,19,22-23,25H,2-7,9-11H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HFSXHZZDNDGLQN-ZVIOFETBSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 561-65-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4U5T0O9SI3

| PubChem = 11222

| SMILES = O=C4\C=C2/[C@]([C@H]1[C@@H](O)C[C@@]3([C@@H](C(=O)CO)CC[C@H]3[C@@H]1CC2)CO)(C)CC4

| MeSHName = 18-hydroxycorticosterone

}}

|Section2={{Chembox Properties

| Formula = C₂₁H₃₀O₅

| MolarMass = 362.46 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}18-Hydroxycorticosterone is an endogenous steroid.{{cite journal | vauthors = Reddish MJ, Guengerich FP | title = Human cytochrome P450 11B2 produces aldosterone by a processive mechanism due to the lactol form of the intermediate 18-hydroxycorticosterone | journal = The Journal of Biological Chemistry | volume = 294 | issue = 35 | pages = 12975–12991 | date = August 2019 | pmid = 31296661 | pmc = 6721951 | doi = 10.1074/jbc.RA119.009830 | doi-access = free }}{{cite journal | vauthors = Mulatero P, di Cella SM, Monticone S, Schiavone D, Manzo M, Mengozzi G, Rabbia F, Terzolo M, Gomez-Sanchez EP, Gomez-Sanchez CE, Veglio F | title = 18-hydroxycorticosterone, 18-hydroxycortisol, and 18-oxocortisol in the diagnosis of primary aldosteronism and its subtypes | journal = The Journal of Clinical Endocrinology and Metabolism | volume = 97 | issue = 3 | pages = 881–9 | date = March 2012 | pmid = 22238407 | doi = 10.1210/jc.2011-2384 | doi-access = free }} It is a derivative of corticosterone.{{cite journal | vauthors = Gupta V | title = Mineralocorticoid hypertension | journal = Indian Journal of Endocrinology and Metabolism | volume = 15 Suppl 4 | issue = 8| pages = S298–312 | date = October 2011 | pmid = 22145132 | pmc = 3230101 | doi = 10.4103/2230-8210.86972 | doi-access = free }}{{cite journal | vauthors = Freel EM, Shakerdi LA, Friel EC, Wallace AM, Davies E, Fraser R, Connell JM | title = Studies on the origin of circulating 18-hydroxycortisol and 18-oxocortisol in normal human subjects | journal = The Journal of Clinical Endocrinology and Metabolism | volume = 89 | issue = 9 | pages = 4628–33 | date = September 2004 | pmid = 15356073 | pmc = 1283128 | doi = 10.1210/jc.2004-0379}}{{cite journal | vauthors = Izumi Y | title = [18-Hydroxycorticosterone (18-OH-B)] | language = ja | journal = Nihon Rinsho. Japanese Journal of Clinical Medicine | volume = 68 | pages = 348–53 | date = July 2010 | issue = Suppl 7 | pmid = 20960793 }}