2,4-Dichloroamphetamine

{{Short description|Serotonergic neurotoxin}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = 2,4-Dichloroamphetamine.svg

| image_class = skin-invert-image

| width = 175px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Psychostimulant; Serotonergic neurotoxin; Monoamine oxidase inhibitor

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 32560-77-3

| CAS_supplemental =

| PubChem = 3041175

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 2304480

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 2,4-DCA

| IUPAC_name = 1-(2,4-dichlorophenyl)propan-2-amine

| C=9 | H=11 | Cl=2 | N=1

| SMILES = CC(CC1=C(C=C(C=C1)Cl)Cl)N

| StdInChI = 1S/C9H11Cl2N/c1-6(12)4-7-2-3-8(10)5-9(7)11/h2-3,5-6H,4,12H2,1H3

| StdInChIKey = WFXOKSCQUWGEEH-UHFFFAOYSA-N

}}

2,4-Dichloroamphetamine (2,4-DCA) is a psychostimulant of the amphetamine family and a potent serotonergic neurotoxin related to para-chloroamphetamine (PCA; 4-chloroamphetamine).{{cite book | vauthors = Biel JH, Bopp BA |chapter=Amphetamines: Structure-Activity Relationships| veditors = Iversen L, Snyder SH, Iversen SD |title=Stimulants |publisher=Springer US |publication-place=Boston, MA |year=1978 |isbn=978-1-4757-0512-6 |doi=10.1007/978-1-4757-0510-2_1 |page=1–39}}{{cite journal | vauthors = Fuller RW, Snoddy HD, Roush BW, Molloy BB | title = Further structure-activity studies on the lowering of brain 5-hydroxyindoles by 4-chloramphetamine | journal = Neuropharmacology | volume = 12 | issue = 1 | pages = 33–42 | date = January 1973 | pmid = 4687274 | doi = 10.1016/0028-3908(73)90129-9 | publisher = Elsevier BV }} It is also a potent monoamine oxidase inhibitor.{{cite journal | vauthors = Conde S, Madroñero R, Fernández-Tomé MP, del Río J | title = Effects of thiophene analogues of chloroamphetamines on central serotonergic mechanisms | journal = Journal of Medicinal Chemistry | volume = 21 | issue = 9 | pages = 978–981 | date = September 1978 | pmid = 722762 | doi = 10.1021/jm00207a024 | publisher = American Chemical Society (ACS) }}