2α-(Propanoyl)-3β-(2-(6-methoxynaphthyl))-tropane

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2α-(Propanoyl)-3β-(2-(6-methoxynaphthyl))-tropane

| image=WF-33.svg

| width= 220

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number= 252958-03-5

| ATC_prefix=

| ATC_suffix=

| PubChem=

| ChemSpiderID =

| DrugBank=

| C=22 | H=27 | N=1 | O=2

| bioavailability=

| metabolism =

| elimination_half-life=

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration=

| StdInChI=1S/C22H27NO2/c1-4-21(24)22-19(13-17-8-10-20(22)23(17)2)16-6-5-15-12-18(25-3)9-7-14(15)11-16/h5-7,9,11-12,17,19-20,22H,4,8,10,13H2,1-3H3/t17?,19-,20?,22-/m1/s1

| StdInChIKey=NBXHPPSAAQZXHP-HJSRJYPHSA-N

| SMILES = CCC(=O)[C@H]1C(CC2)N(C)C2C[C@@H]1C3=CC=C4C=C(OC)C=CC4=C3

}}

2α-(Propanoyl)-3β-(2-(6-methoxynaphthyl))-tropane or WF-33 is a cocaine analogue. It, along with WF-23 the other "2-naphthyl" cocaine analogue, are considered the more potent of the WF series cocaine analogues.{{cite patent | country = US | number = 5763455 | url = https://patents.google.com/patent/US5763455A/en?oq=US5763455 | title = Biologically active tropane derivatives | inventor = Davies HM, Childers SR | assign1 = Wake Forest University Health Sciences | gdate = 9 June 1998 }}