2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477198133
| ImageFile=Photochlor.png
| ImageSize=200px
| IUPACName=
| OtherNames=Photochlor
|Section1={{Chembox Identifiers
| Abbreviations = HPPH
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4589621
| InChI = 1/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1
| InChIKey = ODJVLHDVEGAIAW-NMWXTPPCBI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ODJVLHDVEGAIAW-NMWXTPPCSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=149402-51-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DOB7Y3RSX0
| PubChem=5488034
| SMILES=CCCCCCOC(C)C1=C2C=C3C(=C(C(=CC4=NC5=C(CC(=O)C5=C4C)C6=NC(=CC(=C1C)N2)[C@H]([C@@H]6CCC(=O)O)C)N3)CC)C
}}
|Section2={{Chembox Properties
| C=39 | H=48 | N=4 | O=4
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a (HPPH) is a photosensitiser chemical that is used in photodynamic therapy.{{cite journal | pmid = 11891727 | year = 2001 | last1 = Lobel | first1 = J | last2 = MacDonald | first2 = IJ | last3 = Ciesielski | first3 = MJ | last4 = Barone | first4 = T | last5 = Potter | first5 = WR | last6 = Pollina | first6 = J | last7 = Plunkett | first7 = RJ | last8 = Fenstermaker | first8 = RA | last9 = Dougherty | first9 = TJ | title = 2-1-hexyloxyethyl-2-devinyl pyropheophorbide-a (HPPH) in a nude rat glioma model: implications for photodynamic therapy | volume = 29 | issue = 5 | pages = 397–405 | journal = Lasers in Surgery and Medicine | doi = 10.1002/lsm.10001 | s2cid = 22578518 }}
It is being developed under the brand name Photochlor.
Clinical trials
A phase I/II clinical trial started in 1997 for esophageal cancer.[http://clinicaltrials.gov/ct2/show/NCT00060268 Photodynamic Therapy Using HPPH in Treating Patients With Obstructive Esophageal Tumors]
A phase II trial for non-small cell lung cancer is due to run from 2007 to 2011.[http://clinicaltrials.gov/ct2/show/NCT00528775 Photodynamic Therapy Using HPPH in Treating Patients With Advanced Non-Small Cell Lung Cancer That Blocks the Air Passages]
==References==
{{reflist}}
External links
- [http://clinicaltrials.gov/ct2/results?term=HPPH Clinical trials of HPPH]
{{DEFAULTSORT:Hexyloxyethyl)-2-devinyl pyropheophorbide-a, 2-(1-}}
{{antineoplastic-drug-stub}}