2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477198133

| ImageFile=Photochlor.png

| ImageSize=200px

| IUPACName=

| OtherNames=Photochlor

|Section1={{Chembox Identifiers

| Abbreviations = HPPH

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4589621

| InChI = 1/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1

| InChIKey = ODJVLHDVEGAIAW-NMWXTPPCBI

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ODJVLHDVEGAIAW-NMWXTPPCSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=149402-51-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = DOB7Y3RSX0

| PubChem=5488034

| SMILES=CCCCCCOC(C)C1=C2C=C3C(=C(C(=CC4=NC5=C(CC(=O)C5=C4C)C6=NC(=CC(=C1C)N2)[C@H]([C@@H]6CCC(=O)O)C)N3)CC)C

}}

|Section2={{Chembox Properties

| C=39 | H=48 | N=4 | O=4

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a (HPPH) is a photosensitiser chemical that is used in photodynamic therapy.{{cite journal | pmid = 11891727 | year = 2001 | last1 = Lobel | first1 = J | last2 = MacDonald | first2 = IJ | last3 = Ciesielski | first3 = MJ | last4 = Barone | first4 = T | last5 = Potter | first5 = WR | last6 = Pollina | first6 = J | last7 = Plunkett | first7 = RJ | last8 = Fenstermaker | first8 = RA | last9 = Dougherty | first9 = TJ | title = 2-1-hexyloxyethyl-2-devinyl pyropheophorbide-a (HPPH) in a nude rat glioma model: implications for photodynamic therapy | volume = 29 | issue = 5 | pages = 397–405 | journal = Lasers in Surgery and Medicine | doi = 10.1002/lsm.10001 | s2cid = 22578518 }}

It is being developed under the brand name Photochlor.

Clinical trials

A phase I/II clinical trial started in 1997 for esophageal cancer.[http://clinicaltrials.gov/ct2/show/NCT00060268 Photodynamic Therapy Using HPPH in Treating Patients With Obstructive Esophageal Tumors]

A phase II trial for non-small cell lung cancer is due to run from 2007 to 2011.[http://clinicaltrials.gov/ct2/show/NCT00528775 Photodynamic Therapy Using HPPH in Treating Patients With Advanced Non-Small Cell Lung Cancer That Blocks the Air Passages]

==References==

{{reflist}}