2-Iodomelatonin

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Infobox drug

|IUPHAR_ligand=1343

|ChEBI=109558

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 93515-00-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2Q5TZ5754A

| ChEMBL = 289233

|DrugBank=DB08190

|PubChem=115348

|ChemSpiderID=103191

|IUPAC_name=N-[2-(2-iodo-5-methoxy-1H-indol-3-yl)ethyl]acetamide

|image=2-iodomelatonin.svg

|StdInChIKey=FJDDSMSDZHURBJ-UHFFFAOYSA-N

|StdInChI=1S/C13H15IN2O2/c1-8(17)15-6-5-10-11-7-9(18-2)3-4-12(11)16-13(10)14/h3-4,7,16H,5-6H2,1-2H3,(H,15,17)

|smiles=CC(=O)NCCC1=C(NC2=C1C=C(C=C2)OC)I

|C=13|H=15|I=1|N=2|O=2

}}

2-Iodomelatonin is a melatonin analog used as a radiolabelled ligand for the melatonin receptors, MT₁, MT₂, and MT₃. It acts as a full agonist at both MT₁ and MT₂ receptors.{{cite journal |vauthors=Audinot V, Mailliet F, Lahaye-Brasseur C, Bonnaud A, Le Gall A, Amossé C, Dromaint S, Rodriguez M, Nagel N, Galizzi JP, Malpaux B, Guillaumet G, Lesieur D, Lefoulon F, Renard P, Delagrange P, Boutin JA |title=New selective ligands of human cloned melatonin MT₁ and MT₂ receptors |journal=Naunyn-Schmiedeberg's Arch Pharmacol |volume=367 |issue=6 |pages=553–61 |date=June 2003 |pmid=12764576 |doi=10.1007/s00210-003-0751-2 |s2cid=20279702 |url=}}