2-MCPD

{{Chembox

| ImageFile = 2-mcpd.svg

| ImageSize = 120

| ImageAlt =

| IUPACName =

| OtherNames = 2-monochloropropane-1,3-diol

|Section1={{Chembox Identifiers

| CASNo = 497-04-1

| ChemSpiderID = 9913

| EC_number = 207-834-6

| PubChem = 10337

| UNII = N6ZZ93MWJ4

| StdInChI=1S/C3H7ClO2/c4-3(1-5)2-6/h3,5-6H,1-2H2

| StdInChIKey = DYPJJAAKPQKWTM-UHFFFAOYSA-N

| SMILES = C(C(CO)Cl)O

}}

|Section2={{Chembox Properties

| C = 3|H = 7|O=2|Cl=1

| MolarMass =

| Appearance = colorless liquid

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPtF = 295

| BoilingPt_notes =18 mmHg

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

2-MCPD (2-chloropropane-1,3-diol) is an organic chemical compound with the formula {{chem2|ClCH(CH2(OH))2}}. It is a colorless liquid. The compound has attracted notoreity as a food contaminant. Together with the 3-MCPD, it is one of two chloropropanols food contaminants.{{cite journal|doi=10.1021/es903383a|pmid=20163179|title=Identifying New Persistent and Bioaccumulative Organics Among Chemicals in Commerce|journal=Environmental Science & Technology|volume=44|issue=7|pages=2277–2285|year=2010|last1=Howard|first1=Philip H.|last2=Muir|first2=Derek C. G.|bibcode=2010EnST...44.2277H|doi-access=free}} It is suspected to be carcinogenic in humans.{{cite journal |doi=10.2903/j.efsa.2016.4426 |title=Risks for human health related to the presence of 3- and 2-monochloropropanediol (MCPD), and their fatty acid esters, and glycidyl fatty acid esters in food |journal=EFSA Journal |date=2016 |volume=14 |issue=5 |hdl=2164/7793 |hdl-access=free }}

2-MCPD, together with its isomer 3-MCPD, is thought to be produced when fat-containing foods are treated at high temperatures with hydrochloric acid. Such treatments are sometimes used to accelerate protein hydrolysis, making food more digestable. In such a treatment chloride is thought to react with the glycerol backbone of lipids to produce 2- and 3-MCPD.