21-Deoxycortisone
{{Chembox
| ImageFile = 21-Deoxycortisone.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 17α-Hydroxypregn-4-ene-3,11,20-trione
| SystematicName = (1R,3aS,3bS,9aR,9bS,11aS)-1-Acetyl-1-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,8,9,9a,9b,11,11a-dodecahydro-1H-cyclopenta[a]phenanthrene-7,10-dione
| OtherNames = 21-Desoxycortisone; 11-Keto-17α-hydroxyprogesterone; 17α-Hydroxy-11-ketoprogesterone
| Section1 = {{Chembox Identifiers
| CASNo = 1882-82-2
| ChemSpiderID = 92310
| KEGG = C14478
| PubChem = 102178
| SMILES = CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC(=O)[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O
| StdInChI = 1S/C21H28O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h10,15-16,18,25H,4-9,11H2,1-3H3/t15-,16-,18+,19-,20-,21-/m0/s1
| StdInChIKey = PUKLDDOGISCFCP-JSQCKWNTSA-N
| UNII = 60A688J7YQ
}}
| Section2 = {{Chembox Properties
| C=21 | H=28 | O=4
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
21-Deoxycortisone, also known as 21-desoxycortisone, 11-keto-17α-hydroxyprogesterone, or 17α-hydroxypregn-4-ene-3,11,20-trione, is a naturally occurring, endogenous steroid and minor intermediate and metabolite in corticosteroid metabolism. It is related to 21-deoxycortisol (11β,17α-dihydroxyprogesterone) and is reversibly formed from it by 11β-hydroxysteroid dehydrogenase, analogously to the reversible formation of cortisone from cortisol.{{cite journal | vauthors = Homma K, Hasegawa T, Takeshita E, Watanabe K, Anzo M, Toyoura T, Jinno K, Ohashi T, Hamajima T, Takahashi Y, Takahashi T, Matsuo N | title = Elevated urine pregnanetriolone definitively establishes the diagnosis of classical 21-hydroxylase deficiency in term and preterm neonates | journal = J. Clin. Endocrinol. Metab. | volume = 89 | issue = 12 | pages = 6087–91 | year = 2004 | pmid = 15579762 | doi = 10.1210/jc.2004-0473 | doi-access = free }} 21-Deoxycortisone can be transformed into cortisone by 21-hydroxylase.{{cite journal | vauthors = ROSENFELD G, UNGAR F, DORFMAN RI, PINCUS G | title = Irradiation and adrenal steroidogenesis: steroid transformations by irradiated isolated perfused calf adrenals | journal = Endocrinology | volume = 56 | issue = 1 | pages = 24–9 | year = 1955 | pmid = 13220521 | doi = 10.1210/endo-56-1-24 }}
See also
References
{{Reflist|2}}
{{Endogenous steroids}}
{{DEFAULTSORT:Deoxycortisone, 21-}}
{{steroid-stub}}