25B-NAcPip

{{Infobox drug

| drug_name =

| image = 25B-NAcPip structure.png

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number =

| CAS_supplemental =

| PubChem = 169777235

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID =

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = N-(Piperidin-1-ylcarbonylmethyl)-4-bromo-2,5-dimethoxyphenethylamine

| IUPAC_name = 2-{[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]amino}-1-(piperidin-1-yl)ethan-1-one

| C=17 | H=25 | Br=1 | N=2 | O=3

| SMILES = COc1cc(Br)c(cc1CCNCC(=O)N1CCCCC1)OC

| StdInChI = 1S/C17H25BrN2O3/c1-22-15-11-14(18)16(23-2)10-13(15)6-7-19-12-17(21)20-8-4-3-5-9-20/h10-11,19H,3-9,12H2,1-2H3

| StdInChIKey = NPHDUYTXALMKMJ-UHFFFAOYSA-N

}}

25B-NAcPip is a chemical compound related to the 25-NB family of psychedelic drugs.{{cite web | title=Therapeutic combinations, compositions, and methods for designing and producing entactogenic mindstates | website=Google Patents | date=9 March 2023 | url=https://patents.google.com/patent/WO2023172701A2/ | access-date=15 April 2025}}{{cite web | title=Prevention of drug diversion | website=Google Patents | date=19 April 2022 | url=https://patents.google.com/patent/WO2022221942A1/ | access-date=15 April 2025}}{{cite web | title=PiHKAL·info | website=Isomer Design | url=https://isomerdesign.com/pihkal/explore/3836 | access-date=15 April 2025}} It has been described in patents published by psychedelic pharmaceutical companies like Betterlife Pharma and Mindstate Design Labs. Uniquely among 25-NB compounds, 25B-NAcPip is similar to simplified/partial lysergamides and has elements of the chemical structure of LSD and related psychedelic lysergamides like LSD-Pip within its structure.