25C-NB4OMe

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid =

| IUPAC_name = 2-(4-Chloro-2,5-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]ethanamine

| image = 25C-NB4OMe.svg

| width = 200px

| tradename =

| pregnancy_category =

| routes_of_administration =

| legal_UK = Class A drug

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 1566571-35-4

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SZ8M8K1LLK

| ATC_prefix = none

| PubChem = 118796506

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 52085660

| C=18 | H=22 | Cl=1 | N=1 | O=3

| smiles = COC1=CC=C(C=C1)CNCCC2=CC(=C(C=C2OC)Cl)OC

| StdInChI = 1S/C18H22ClNO3/c1-21-15-6-4-13(5-7-15)12-20-9-8-14-10-18(23-3)16(19)11-17(14)22-2/h4-7,10-11,20H,8-9,12H2,1-3H3

| StdInChIKey = QEGZBQXBCVUMCU-UHFFFAOYSA-N

}}

25C-NB4OMe (2C-C-NB4OMe, NB4OMe-2C-C) is a derivative of the phenethylamine hallucinogen 2C-C, which acts as a partial agonist for the human 5-HT_2A receptor.{{cite journal | vauthors = Hansen M, Phonekeo K, Paine JS, Leth-Petersen S, Begtrup M, Bräuner-Osborne H, Kristensen JL | title = Synthesis and structure-activity relationships of N-benzyl phenethylamines as 5-HT2A/2C agonists | journal = ACS Chemical Neuroscience | volume = 5 | issue = 3 | pages = 243–249 | date = March 2014 | pmid = 24397362 | pmc = 3963123 | doi = 10.1021/cn400216u }}