2C-iP

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-[2,5-Dimethoxy-4-(propan-2-yl)phenyl]ethan-1-amine

| image = 2C-iP_structure.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_status =

| legal_DE = NpSG

| legal_UK = Class A

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1498978-47-4

| ATC_prefix =

| ATC_suffix =

| PubChem = 57474311

| ChemSpiderID = 27750188

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4TT057Y1ST

| C=13 | H=21 | N=1 | O=2

| melting_point =

| smiles = COC1=C(C=C(C(=C1)C(C)C)OC)CCN

| StdInChI = 1S/C13H21NO2/c1-9(2)11-8-12(15-3)10(5-6-14)7-13(11)16-4/h7-9H,5-6,14H2,1-4H3

| StdInChIKey = XUGPCRRUMVWELT-UHFFFAOYSA-N

}}

2C-iP (also known as Jelena) is a relatively potent and long acting psychedelic phenethylamine and compound from the 2C family that was first synthesized by Dmitri Ger and has been sold online as a designer drug.{{cite web | url=http://bitnest.ca/external.php?id=%250E%251C%2517%2526x%255EYB%2519%2505 | title=Triple Goddess of the Night | publisher=British Neuroscience Association Bulletin | date=1 March 2011 | access-date=16 July 2015 | vauthors = Ger A, Ger D| archive-url=https://web.archive.org/web/20140219143756/http://bitnest.ca/external.php?id=%250E%251C%2517%2526x%255EYB%2519%2505 | archive-date=19 February 2014 | url-status=dead }}{{cite web | url=http://countyourculture.com/2010/10/04/the-alkylated-2cs/ | title=The alkylated 2Cs | publisher=countyourculture | date=4 October 2010 | access-date=16 July 2015 | vauthors=Meyers-Riggs B | archive-date=21 July 2015 | archive-url=https://web.archive.org/web/20150721214848/http://countyourculture.com/2010/10/04/the-alkylated-2cs/ | url-status=dead }}

It is a structural analog of 2C-P.