2CE-5iPrO

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(5-(propan-2-yloxy)-2-methoxy-4-ethylphenyl)-ethan-1-amine

| image = 2CE-5iPrO_structure.png

| width = 200

| tradename =

| CAS_number = 2570936-85-3

| CAS_number_Ref = {{cascite|correct|CAS}}

| PubChem =

| ChemSpiderID =

| C=14 | H=23 | N=1 | O=2

| smiles = COc1cc(CC)c(cc1CCN)OC(C)C

| StdInChI = 1S/C14H23NO2/c1-5-11-8-13(16-4)12(6-7-15)9-14(11)17-10(2)3/h8-10H,5-7,15H2,1-4H3

| StdInChIKey = WBECSSJDHFYNMA-UHFFFAOYSA-N

}}

2CE-5iPrO (5-iPrO-2C-E) is a psychedelic substituted phenethylamine derivative related to 2C-E, but with the 5-methoxy group extended to isopropoxy. Similar to related "tweetio" compounds such as 2CD-5EtO, it has a longer duration of action than 2C-E but is otherwise similar in activity, although it shows reduced antiinflammatory actions.{{cite journal | vauthors = Flanagan TW, Billac GB, Landry AN, Sebastian MN, Cormier SA, Nichols CD | title = Structure-Activity Relationship Analysis of Psychedelics in a Rat Model of Asthma Reveals the Anti-Inflammatory Pharmacophore | journal = ACS Pharmacology & Translational Science | volume = 4 | issue = 2 | pages = 488–502 | date = April 2021 | pmid = 33860179 | pmc = 8033619 | doi = 10.1021/acsptsci.0c00063 }}