3α-Hydroxytibolone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (3R,7R,8R,9S,13S,14S,17R)-17-Ethynyl-7,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol

| image = 3α-Hydroxytibolone.svg

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 100239-44-9

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 10087021

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 8262558

| UNII = 37T303O94A

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = ORG-4094; 7α-Methyl-17α-ethynylestr-5(10)-ene-3α,17β-diol

| C=21 | H=30 | O=2

| SMILES = C[C@@H]1CC2=C(CC[C@H](C2)O)[C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C#C)O

| StdInChI_Ref =

| StdInChI = 1S/C21H30O2/c1-4-21(23)10-8-18-19-13(2)11-14-12-15(22)5-6-16(14)17(19)7-9-20(18,21)3/h1,13,15,17-19,22-23H,5-12H2,2-3H3/t13-,15-,17-,18+,19-,20+,21+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = YLEUWNOTNJZCBN-CZTKNSHGSA-N

}}

3α-Hydroxytibolone (developmental code name ORG-4094) is a synthetic steroidal estrogen which was never marketed.{{cite journal|last1=Kuhl|first1=H|title=Pharmacology of estrogens and progestogens: influence of different routes of administration|journal=Climacteric|volume=8|issue=sup1|year=2005|pages=3–63|issn=1369-7137|doi=10.1080/13697130500148875|pmid=16112947|s2cid=24616324}}{{cite journal | vauthors = Escande A, Servant N, Rabenoelina F, Auzou G, Kloosterboer H, Cavaillès V, Balaguer P, Maudelonde T | title = Regulation of activities of steroid hormone receptors by tibolone and its primary metabolites | journal = J. Steroid Biochem. Mol. Biol. | volume = 116 | issue = 1–2 | pages = 8–14 | year = 2009 | pmid = 19464167 | doi = 10.1016/j.jsbmb.2009.03.008 | s2cid = 18346113 | url = http://www.hal.inserm.fr/inserm-00396319/document}} Along with 3β-hydroxytibolone and δ⁴-tibolone, it is a major active metabolite of tibolone, and 3α-hydroxytibolone and 3β-hydroxytibolone are thought to be responsible for the estrogenic activity of tibolone.