3β-Androstenol
{{short description|Chemical compound}}
{{Chembox
| ImageFile = 3β-Androstenol.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 5α-Androst-16-en-3β-ol
| SystematicName = (3aS,3bR,5aS,7S,9aS,9bS,11aR)-9a,11a-Dimethyl-3a,3b,4,5,5a,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-3H-cyclopenta[a]phenanthren-7-ol
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 7148-51-8
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = EPQ9QH9KXZ
| ChemSpiderID = 133479
| StdInChI = 1S/C19H30O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13-17,20H,4-8,10-12H2,1-2H3/t13-,14-,15-,16-,17-,18-,19-/m0/s1
| StdInChIKey = KRVXMNNRSSQZJP-LOVVWNRFSA-N
| PubChem = 151449
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CC[C@@H]4[C@@]3(CC[C@@H](C4)O)C
}}
| Section2 = {{Chembox Properties
| C=19 | H=30 | O=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
{{Distinguish|3α-Androstenol}}
3β-Androstenol, also known as 5α-androst-16-en-3β-ol, is a naturally occurring mammalian pheromone known to be present in humans and pigs.{{cite journal | vauthors = Kanlayavattanakul M, Lourith N | title = Body malodours and their topical treatment agents | journal = International Journal of Cosmetic Science | volume = 33 | issue = 4 | pages = 298–311 | year = 2011 | pmid = 21401651 | doi = 10.1111/j.1468-2494.2011.00649.x | s2cid = 11235250 | doi-access = free }}{{cite book|author=Richard L. Doty|title=The Great Pheromone Myth|url=https://books.google.com/books?id=oZmk-XWeAn8C&pg=PA139|date=27 January 2010|publisher=JHU Press|isbn=978-0-8018-9347-6|pages=139–}}{{cite journal | vauthors = Fischer J, Elsinghorst PW, Bücking M, Tholen E, Petersen B, Wüst M | title = Development of a candidate reference method for the simultaneous quantitation of the boar taint compounds androstenone, 3α-androstenol, 3β-androstenol, skatole, and indole in pig fat by means of stable isotope dilution analysis-headspace solid-phase microextraction-gas chromatography/mass spectrometry | journal = Anal. Chem. | volume = 83 | issue = 17 | pages = 6785–91 | year = 2011 | pmid = 21800819 | doi = 10.1021/ac201465q }} It is thought to play a role in axillary odor. It is produced from androstenone via the enzyme 3β-hydroxysteroid dehydrogenase. Unlike its C3α epimer 3α-androstenol, 3β-androstenol shows no potentiation of the GABAA receptor or anticonvulsant activity.{{cite journal | vauthors = Sinclair PA, Hancock S, Gilmore WJ, Squires EJ | title = Metabolism of the 16-androstene steroids in primary cultured porcine hepatocytes | journal = J. Steroid Biochem. Mol. Biol. | volume = 96 | issue = 1 | pages = 79–87 | year = 2005 | pmid = 15896952 | doi = 10.1016/j.jsbmb.2005.01.030 | s2cid = 9435153 }}
See also
References
{{Reflist|2}}
{{Pheromones and pherines}}
{{Endogenous steroids}}
{{DEFAULTSORT:Androstenol, 3β-}}