3-Chloro-PCP

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{drugbox

| drug_name = 3-Chloro-PCP

| image = 3-Chloro-PCP.svg

| image_class = skin-invert-image

| legal_CA = Schedule I

| legal_UK = Class B

| legal_DE = NpSG

| C = 17 | H = 24 | Cl = 1 | N = 1

| IUPAC_name = 1-[1-(3-chlorophenyl)cyclohexyl]piperidine

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2201-32-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BG2WV34L9L

| ChemSpiderID =

| PubChem = 125502037

| smiles = C1CCC(CC1)(C2=CC(=CC=C2)Cl)N3CCCCC3

| StdInChI = 1S/C17H24ClN/c18-16-9-7-8-15(14-16)17(10-3-1-4-11-17)19-12-5-2-6-13-19/h7-9,14H,1-6,10-13H2

| StdInChIKey = HUHBTESMMFLCAN-UHFFFAOYSA-N

}}

3-Chloro-PCP (3'-Cl-PCP) is a recreational designer drug from the arylcyclohexylamine family, with dissociative effects. It has comparable potency to phencyclidine but with a slightly different effects profile, being somewhat more potent as an NMDA antagonist but around the same potency as a dopamine reuptake inhibitor.{{cite journal | vauthors = Catalani V, Arillotta D, Corkery JM, Guirguis A, Vento A, Schifano F | title = Identifying New/Emerging Psychoactive Substances at the Time of COVID-19; A Web-Based Approach | journal = Frontiers in Psychiatry | volume = 11 | issue = | pages = 632405 | date = 2020 | pmid = 33633599 | pmc = 7900492 | doi = 10.3389/fpsyt.2020.632405 | doi-access = free }} It was first identified in Slovenia in December 2020,{{cite web | url = https://www.policija.si/apps/nfl_response_web/0_Analytical_Reports_final/3Cl-PCP-ID-2201-20_report.pdf | title = Analytical Report. 3Cl-PCP (C17H24ClN). 1-[1-(3-chlorophenyl)cyclohexyl]piperidine. | work = National Forensic Laboratory | location = Slovenia }} and was made illegal in Hungary in April 2021.{{cite web | url = https://ec.europa.eu/growth/tools-databases/tris/index.cfm/en/search/?trisaction=search.detail&year=2021&num=225&dLang=EN | title = Amendment of Minister for Human Capacities Decree No 55/2014 on substances or groups of compounds classified as new psychoactive substances, 2021/225/HU | date = 30 December 2014 | work = Minister for Human Capacities }}