3-Hydroxykynurenine

{{chembox

| Verifiedfields = changed

| verifiedrevid = 477218877

| ImageFile=3-hydroxykynurenine.png

| ImageSize=200px

| ImageAlt = Skeletal formula of 3-hydroxykynurenine

| ImageFile1 = 3-Hydroxy-L-kynurenine-zwitterion-3D-balls.png

| ImageAlt1 = Ball-and-stick model of the 3-hydroxykynurenine molecule as a zwitterion

| IUPACName=2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid

| OtherNames=

|Section1={{Chembox Identifiers

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C02794

| InChI = 1/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16)

| InChIKey = VCKPUUFAIGNJHC-UHFFFAOYAF

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 442576

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VCKPUUFAIGNJHC-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=484-78-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 27723548JL

| PubChem=89

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 1547

| SMILES = O=C(O)C(N)CC(=O)c1cccc(O)c1N

| MeSHName=3-hydroxykynurenine

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 87

}}

|Section2={{Chembox Properties

| Formula=C₁₀H₁₂N₂O₄

| MolarMass=224.21 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

3-Hydroxykynurenine is a metabolite of tryptophan, which filters UV light in the human lens.{{cite journal|last1=Malina|first1=HZ|last2=Martin |first2=XD|title=Deamination of 3-hydroxykynurenine in bovine lenses: a possible mechanism of cataract formation in general.|journal=Graefes Arch Clin Exp Ophthalmol|year=1995|volume=233|issue=1|pages=38–44|pmid=7721122|doi=10.1007/bf00177784|s2cid=25414197}} It is one of two pigments identified as responsible for the goldenrod crab spider's (Misumena vatia) yellow coloration.

image:Kynurenine pathway wordless.svg, which connects quinolinic acid to tryptophan. The pathway is named for the first intermediate, kynurenine, which is a precursor to kynurenic acid and 3-hydroxykynurenine.{{cite journal|last=Schwarcz|first=Robert |author2=John P. Bruno |author3=Paul J. Muchowski |author4=Hui-Qiu Wu|title=Kynurenines in the Mammalian Brain: When Physiology Meets Pathology|journal=Nature Reviews Neuroscience|date=July 2012|volume=13|pages=465–477|doi=10.1038/nrn3257|issue=7|pmid=22678511 |pmc=3681811}}]]