3-Methyluridine

{{Chembox

| ImageFile = 3-Methyluridine.svg

| ImageSize = 200px

| IUPACName = 3-Methyluridine

| SystematicName = 1-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4(1H,3H)-dione

| OtherNames = N3-Methyluridine; N-3-Methyluridine

| Section1 = {{Chembox Identifiers

| CASNo = 2140-69-4

| PubChem = 99592

| ChemSpiderID = 29272117

| ChEBI = 89487

| StdInChI=1S/C10H14N2O6/c1-11-6(14)2-3-12(10(11)17)9-8(16)7(15)5(4-13)18-9/h2-3,5,7-9,13,15-16H,4H2,1H3/t5-,7-,8-,9-/m1/s1

| StdInChIKey = UTQUILVPBZEHTK-ZOQUXTDFSA-N

| SMILES = CN1C(=O)C=CN(C1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O

}}

| Section2 = {{Chembox Properties

| C=10|H=14|N=2|O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

The chemical compound 3-methyluridine, also called N3-methyluridine, is a pyrimidine nucleoside (abbreviated m3U). In living organisms it is present as RNA modification which has been detected in 23S rRNA of archaea, 16S and 23S rRNA of eubacteria, and 18S, 25S, and 28S of eukaryotic ribosomal RNAs.{{Cite journal|last=Desaulniers|first=Jean-Paul|last2=Chui|first2=Helen M.-P.|last3=Chow|first3=Christine S.|date=2005-12-15|title=Solution conformations of two naturally occurring RNA nucleosides: 3-methyluridine and 3-methylpseudouridine|journal=Bioorganic & Medicinal Chemistry|volume=13|issue=24|pages=6777–6781|doi=10.1016/j.bmc.2005.07.061|issn=0968-0896|pmid=16125393}}