3C-E

{{Short description|Psychedelic drug}}

{{one source|date=July 2019}}

{{Drugbox

| IUPAC_name = 1-(4-Ethoxy-3,5-dimethoxyphenyl)propan-2-amine

| image = 3C-E.svg

| tradename =

| pregnancy_category =

| legal_CA = Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| legal_US = Analogue of a Schedule I drug, possibly illegal under the Federal Analog Act

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 146849-92-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W9QX56V5RU

| PubChem = 44350137

| ChemSpiderID = 21106237

| ChEMBL = 128038

| C=13 | H=21 | N=1 | O=3

| molecular_weight =

| smiles = CCOc1c(cc(cc1OC)CC(C)N)OC

| StdInChI = 1S/C13H21NO3/c1-5-17-13-11(15-3)7-10(6-9(2)14)8-12(13)16-4/h7-9H,5-6,14H2,1-4H3

| StdInChIKey = AHLXCGRWNKUNTQ-UHFFFAOYSA-N

}}

3C-E (3,5-Dimethoxy-4-ethoxyamphetamine) is a psychedelic of the amphetamine class. It was first synthesized by Alexander Shulgin. In his book PiHKAL, Shulgin lists the dosage range as 30 to 60 mg, consumed orally.[https://www.erowid.org/library/books_online/pihkal/pihkal025.shtml PiHKAL entry]{{cite journal | vauthors = Halberstadt AL, Chatha M, Klein AK, Wallach J, Brandt SD | title = Correlation between the potency of hallucinogens in the mouse head-twitch response assay and their behavioral and subjective effects in other species | journal = Neuropharmacology | volume = 167 | issue = | pages = 107933 | date = May 2020 | pmid = 31917152 | pmc = 9191653 | doi = 10.1016/j.neuropharm.2019.107933 | url = http://usdbiology.com/cliff/Courses/Advanced%20Seminars%20in%20Neuroendocrinology/Serotonergic%20Psychedelics%2020/Halberstadt%2020%20Neuropharm%20potency%20of%20hallucinogens%20%20head-twitch.pdf | quote = Table 4 Human potency data for selected hallucinogens. [...] }} The duration of action was stated to be 8–12 hours.

This compound is the amphetamine analog of escaline.