4,4'-Dihydroxybenzophenone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477220615

| Name = 4,4′-Dihydroxybenzophenone

| ImageFile = Dihydroxybenzophenone.svg

| PIN = Bis(4-hydroxyphenyl)methanone

| OtherNames = Benzophenone, 4,4′-dihydroxy-(7Cl,8Cl); 4,4′-dihydroxydiphenyl ketone; Bis(4-hydroxyphenyl) ketone; HBP; HBP (ketone); NSC

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 62365

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C14220

| InChI = 1/C13H10O3/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,14-15H

| InChIKey = RXNYJUSEXLAVNQ-UHFFFAOYAR

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB07635

| PubChem = 69150

| EC_number = 210-288-1

| UNII = HZR7D31SBY

| SMILES = O=C(c1ccc(O)cc1)c2ccc(O)cc2

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 194859

| ChEBI = 34365

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H10O3/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,14-15H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RXNYJUSEXLAVNQ-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 611-99-4

}}

|Section2={{Chembox Properties

| Formula = C₁₃H₁₀O₃

| MolarMass = 214.22 g/mol

| Appearance = Off white/yellow solid

| Solubility = 0.45 g/L

| MeltingPtC = 213 to 215

| MeltingPt_notes =

| BoilingPtC = 444.8

| BoilingPt_notes = @760mmHg

| Density = 1.302g/cm3

}}

|Section3={{Chembox Hazards

| FlashPtC = 237

| ExternalSDS = [https://fscimage.fishersci.com/msds/81424.htm MSDS by Fisher Scientific]

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|317|319|335}}

| PPhrases = {{P-phrases|261|264|271|272|280|302+352|304+340|305+351+338|312|321|332+313|333+313|337+313|362|363|403+233|405|501}}

}}

}}

4,4′-Dihydroxybenzophenone is an organic compound with the formula (HOC₆H₄)₂CO. This off-white solid is a precursor to, or a degradation product of, diverse commercial materials. It is a potential endocrine disruptor.{{cite journal |last1=Eddine |first1=Ali Nasser |last2=von Kries |first2=Jens P. |last3=Podust |first3=Mikhail V. |last4=Warrier |first4=Thulasi |last5=Kaufmann |first5=Stefan H. E. |last6=Podust |first6=Larissa M. |date=2008 |title=X-ray structure of 4,4′-dihydroxybenzophenone mimicking sterol substrate in the active site of sterol 14α-demethylase (CYP51) |title-link=doi |journal=Journal of Biological Chemistry |volume=283 |issue=22 |pages=15152–15159 |doi=10.1074/jbc.M801145200 |pmc=2397474 |pmid=18367444 |doi-access=free |s2cid=22025443 |s2cid-access=free}}