4,5-MDO-DMT

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 455012712

| ImageFile = 4,5-MDO-DMT.svg

| ImageSize = 200px

| PIN = 2-(2H,6H-[1,3]Dioxolo[4,5-e]indol-8-yl)-N,N-dimethylethan-1-amine

| OtherNames = 4,5-Methylenedioxy-N,N-dimethyltryptamine

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 81249-30-1

| PubChem = 44278540

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 23126498

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 28354

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L83E2J7P8Z

| SMILES = CN(C)CCC1=CNC2=C1C(OCO3)=C3C=C2

| InChI = 1S/C13H16N2O2/c1-15(2)6-5-9-7-14-10-3-4-11-13(12(9)10)17-8-16-11/h3-4,7,14H,5-6,8H2,1-2H3

| InChIKey = ZMKRWFZFMOKVCP-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula =

| C=13 | H=16 | N=2 | O=2

| MolarMass =

| Appearance =

| Density =

| MeltingPtC = 93-95

| MeltingPt_ref = {{cite journal|last1=Kline|first1=Toni B.|last2=Benington|first2=Frederick|last3=Morin|first3=Richard D.|last4=Beaton|first4=John M.|title=Structure-activity relationships in potentially hallucinogenic N,N-dialkyltryptamines substituted in the benzene moiety|journal=Journal of Medicinal Chemistry|date=August 1982|volume=25|issue=8|pages=908–913|doi=10.1021/jm00350a005|pmid=7120280}}

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

4,5-MDO-DMT, or 4,5-methylenedioxy-N,N-dimethyltryptamine, is a lesser-known psychedelic drug. It is the 4,5-methylenedioxy analog of DMT. 4,5-MDO-DMT was first synthesized by Alexander Shulgin, though in his book TiHKAL it was not tested to determine its psychoactive effects. 4,5-MDO-DMT has been the subject of limited subsequent testing; with behavioral disruption studies performed in male rats indicating that its hallucinogenic potency is less than that of 4,5-MDO-DiPT but greater than that of 5,6-MDO-DiPT.