4-DAMP

{{Chembox

| ImageFile = 4-DAMP.svg

| ImageSize = 200px

| ImageFile2 = File:4-DAMP-3D-balls-by-AHRLS-2012.png

| ImageSize2 = 200px

| PIN = 4-[(Diphenylacetyl)oxy]-1,1-dimethylpiperidin-1-ium iodide

| OtherNames = 4-(2,2-Diphenylacetoxy)-1,1-dimethylpiperidin-1-ium iodide

| Section1 = {{Chembox Identifiers

| CASNo = 1952-15-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CP6GVV66RG

| PubChem = 3014059

| ChemSpiderID = 2282596

| SMILES = [I-].C[N+]1(C)CCC(CC1)OC(=O)C(C1=CC=CC=C1)C1=CC=CC=C1

| StdInChI = 1S/C21H26NO2.HI/c1-22(2)15-13-19(14-16-22)24-21(23)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19-20H,13-16H2,1-2H3;1H/q+1;/p-1

| StdInChIKey = WWJHRSCUAQPFQO-UHFFFAOYSA-M

}}

| Section2 = {{Chembox Properties

| C=21|H=26|I=1|N=1|O=2

| Appearance = White to beige powder{{cite web | url = http://www.sigmaaldrich.com/catalog/product/sigma/sml0255?lang=en | title = 4-DAMP | publisher = Sigma-Aldrich}}

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

4-DAMP (1,1-dimethyl-4-diphenylacetoxypiperidinium iodide) is a selective muscarinic acetylcholine receptor (mAChR) M₃ antagonist.{{cite journal|author1=Zhu, MH|author2=Sung, IK|author3=Zheng, H|author4=Sung, TS|author5=Britton, FC|author6=O'Driscoll, K|author7=Koh, SD|author8=Sanders, KM|title=Muscarinic activation of Ca2+-activated Cl- current in interstitial cells of Cajal|journal=J Physiol|year=2011|volume=589|issue=Pt18|pages=4565–4582|pmid=21768263|doi=10.1113/jphysiol.2011.211094|pmc=3208225}} It is also able to antagonize M₁ receptors but has preferential activity at the M₃ receptor.{{cite journal|author1=Teixeira-Neto, FJ|author2=McDonell, WN|author3= Black, WD|author4= Harris, W and |author5=Grovum, L|title=Effects of muscarinic receptor antagonists on acetylcholine-induced contractions of jejunal smooth muscle in horses|journal=Journal of Veterinary Pharmacology and Therapeutics|year=2012|volume=35|issue=4|pages=313–318|pmid=21859432|doi=10.1111/j.1365-2885.2011.01330.x}}{{cite journal|author1=Greenwood, JM and |author2=Dragunow, M|title=M3 muscarinic receptors promote cell survival through activation of the extracellular regulated kinase (ERK1/2) pathway|journal=Eur J Pharmacol|year=2010|volume=640|issue=1–3|pages=38–45|pmid=20519144|doi=10.1016/j.ejphar.2010.05.013}} It competitively binds to the acetylcholine binding site on mAChRs, causing right-ward shift in the dose response curves for mAChR agonists.