4-Hydroxyphenylacetic acid

{{chembox

| verifiedrevid = 456503066

| Name = 4-Hydroxyphenylacetic acid

| ImageFile = 4-Hydroxyphenylacetic acid.svg

| ImageSize = 200px

| ImageName = Chemical structure of 4-hydroxyphenylacetic acid

| ImageAlt = Chemical structure of 4-hydroxyphenylacetic acid

| PIN = (4-Hydroxyphenyl)acetic acid

| OtherNames = p-Hydroxyphenylacetic acid

|Section1= {{Chembox Identifiers

| CASNo = 156-38-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3J9SHG0RCN

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C00642

| EINECS = 205-851-3

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1772

| PubChem = 127

| Beilstein = 1448766

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 124

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 18101

| SMILES = O=C(O)Cc1ccc(O)cc1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C8H8O3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XQXPVVBIMDBYFF-UHFFFAOYSA-N

| MeSHName =

}}

|Section2= {{Chembox Properties

| C=8|H=8|O=3

| Appearance = Beige powder

| Density =

| MeltingPtC = 150

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| ExternalSDS = [http://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=US&language=en&productNumber=H50004&brand=ALDRICH&PageToGoToURL=http%3A%2F%2Fwww.sigmaaldrich.com%2Fcatalog%2Fproduct%2Faldrich%2Fh50004%3Flang%3Den MSDS at Sigma Aldrich]

}}

}}

4-Hydroxyphenylacetic acid is a chemical compound found in olive oil{{cite journal | last1 = Papadopoulos | first1 = George | last2 = Boskou | first2 = Dimitrios | title = Antioxidant effect of natural phenols on olive oil | journal = Journal of the American Oil Chemists' Society | volume = 68 | pages = 669 | year = 1991 | doi = 10.1007/BF02662292 | issue = 9| s2cid = 85234954 }} and beer.Determination of free and bound phenolic acids in beer. M. Nardini and A. Ghiselli, Food Chemistry, January 2004, Volume 84, Issue 1, Pages 137–143, {{doi|10.1016/S0308-8146(03)00257-7}}