4C-MAR

{{Short description|Chemical compound}}

{{drugbox

| drug_name = 4'-Chloro-4-methylaminorex

| image = 4C-MAR_structure.png

| image_class = skin-invert-image

| legal_UK =

| legal_DE =

| C = 10 | H = 11 | Cl = 1 | N = 2 | O = 1

| IUPAC_name = 4-methyl-5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 3063572-02-8

| UNII =

| ChemSpiderID =

| PubChem = 165361753

| smiles = CC1C(OC(=N1)N)C2=CC=C(C=C2)Cl

| StdInChI = 1S/C10H11ClN2O/c1-6-9(14-10(12)13-6)7-2-4-8(11)5-3-7/h2-6,9H,1H3,(H2,12,13)

| StdInChIKey = PEMJVPLFSLEVII-UHFFFAOYSA-N

}}

4'-Chloro-4-methylaminorex (4C-MAR, 4'-Cl-4-MAR) is a recreational designer drug from the substituted aminorex family, with stimulant effects. It has reportedly been sold since around 2021 and was first definitively identified in Austria in January 2022.{{cite journal | vauthors = Seibert E, Kunert O, Pferschy-Wenzig EM, Schmid MG | title = Characterization of Three Novel 4-Methylaminorex Derivatives Applied as Designer Drugs | journal = Molecules | location = Basel, Switzerland | volume = 27 | issue = 18 | date = September 2022 | page = 5770 | pmid = 36144500 | pmc = 9503756 | doi = 10.3390/molecules27185770 | doi-access = free }}