5,6-MeO-MiPT

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name = 5,6-MeO-MiPT

| image = 5,6-MeO-MiPT.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 96096-58-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BS78RK38CG

| PubChem = 44382345

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 23511916

| KEGG =

| ChEBI =

| ChEMBL = 172460

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 5,6-dimethoxy-N-methyl-N-isopropyltryptamine

| IUPAC_name = N-[2-(5,6-dimethoxy-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine

| C=16 | H=24 | N=2 | O=2

| SMILES = CC(C)N(C)CCc2c[nH]c1cc(OC)c(OC)cc12

| StdInChI = 1S/C16H24N2O2/c1-11(2)18(3)7-6-12-10-17-14-9-16(20-5)15(19-4)8-13(12)14/h8-11,17H,6-7H2,1-5H3

| StdInChIKey = XXWWFLAMFUOAQG-UHFFFAOYSA-N

}}

5,6-MeO-MiPT, or 5,6-dimethoxy-N-methyl-N-isopropyltryptamine, is a lesser-known psychedelic drug. It is the 5,6-dimethoxy analog of MiPT. 5,6-MeO-MiPT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), 5,6-MeO-MiPT produces no noticeable psychoactive effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of 5,6-MeO-MiPT.