5-EAPB

{{Short description|Chemical compound}}

{{Use dmy dates|date=July 2015}}

{{Drugbox

| Verifiedfields =

| verifiedrevid =

| IUPAC_name = 1-(1-Benzofuran-5-yl)-N-ethylpropan-2-amine

| image = 5-EAPB Structure.svg

| image2 = 5-EAPB molecule ball.png

| alt2 = Ball-and-stick model of 5-EAPB molecule

| tradename =

| pregnancy_category = ?

| legal_status =

| legal_BR = F2

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}

| legal_CA = Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 1445566-01-7

| ATC_prefix = none

| ATC_suffix =

| PubChem =

| ChemSpiderID = 32078888

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 889D8VM2SL

| C=13 | H=17 | N=1 | O=1

| molecular_weight = 203.28 g/mol (freebase) 239.78 g/mol (hydrochloride)

| smiles = CC(NCC)CC1=CC(C=CO2)=C2C=C1

| StdInChI = 1S/C13H17NO/c1-3-14-10(2)8-11-4-5-13-12(9-11)6-7-15-13/h4-7,9-10,14H,3,8H2,1-2H3

| StdInChIKey = ZBZDDOARNPAMSP-UHFFFAOYSA-N

}}

5-EAPB (1-(benzofuran-5-yl)-N-ethylpropan-2-amine) is a potentially entactogenic amphetamine which is structurally related to 5-MAPB and 5-APB. It might be predicted to show similar effects to these drugs in humans, but the pharmacology of 5-EAPB remains unstudied as of 2020.

5-EAPB is similar in structure to compounds such as 5-APB which are claimed to be agonists of the 5-HT_2C receptor{{ cite patent | country = US | number = 7045545 | status = patent | title = Aminoalkylbenzofurans as serotonin (5-HT(2c)) agonists | pubdate = 2000-01-19 | gdate = 2006-16-03 | inventor = Briner K, Burkhart P, Burkholder P, Fisher MJ, Gritton WH, Kohlman DT, Liang SX, Miller SC, Mullaney JT, Xu YX | assign = Eli Lilly and Co }} as well as a triple monoamine reuptake inhibitor, however 5-EAPB is not listed as an example in this patent, and it is not yet established to what extent the activity of 5-EAPB resembles that of 5-APB.