5-EAPB
{{Short description|Chemical compound}}
{{Use dmy dates|date=July 2015}}
{{Drugbox
| Verifiedfields =
| verifiedrevid =
| IUPAC_name = 1-(1-Benzofuran-5-yl)-N-ethylpropan-2-amine
| image = 5-EAPB Structure.svg
| image2 = 5-EAPB molecule ball.png
| alt2 = Ball-and-stick model of 5-EAPB molecule
| tradename =
| pregnancy_category = ?
| legal_status =
| legal_BR = F2
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}
| legal_CA = Schedule I
| legal_DE = NpSG
| legal_UK = Class B
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 1445566-01-7
| ATC_prefix = none
| ATC_suffix =
| PubChem =
| ChemSpiderID = 32078888
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 889D8VM2SL
| C=13 | H=17 | N=1 | O=1
| molecular_weight = 203.28 g/mol (freebase) 239.78 g/mol (hydrochloride)
| smiles = CC(NCC)CC1=CC(C=CO2)=C2C=C1
| StdInChI = 1S/C13H17NO/c1-3-14-10(2)8-11-4-5-13-12(9-11)6-7-15-13/h4-7,9-10,14H,3,8H2,1-2H3
| StdInChIKey = ZBZDDOARNPAMSP-UHFFFAOYSA-N
}}
5-EAPB (1-(benzofuran-5-yl)-N-ethylpropan-2-amine) is a potentially entactogenic amphetamine which is structurally related to 5-MAPB and 5-APB. It might be predicted to show similar effects to these drugs in humans, but the pharmacology of 5-EAPB remains unstudied as of 2020.
5-EAPB is similar in structure to compounds such as 5-APB which are claimed to be agonists of the 5-HT2C receptor{{ cite patent | country = US | number = 7045545 | status = patent | title = Aminoalkylbenzofurans as serotonin (5-HT(2c)) agonists | pubdate = 2000-01-19 | gdate = 2006-16-03 | inventor = Briner K, Burkhart P, Burkholder P, Fisher MJ, Gritton WH, Kohlman DT, Liang SX, Miller SC, Mullaney JT, Xu YX | assign = Eli Lilly and Co }} as well as a triple monoamine reuptake inhibitor, however 5-EAPB is not listed as an example in this patent, and it is not yet established to what extent the activity of 5-EAPB resembles that of 5-APB.
Legality
In the UK, all benzofurans are considered Class B drugs{{cite web | date = 10 June 2014 | title = Ban on NBOMe and benzofurans comes into force | url = https://www.gov.uk/government/news/ban-on-nbome-and-benzofurans-comes-into-force | work = Gov.uk }} and are therefore illegal.
5-EAPB is listed in the Fifth Schedule of the Misuse of Drugs Act (MDA) and therefore illegal in Singapore as of May 2015.{{cite web | url=http://www.cnb.gov.sg/Libraries/CNB_Newsroom_Files/CNB_NR_-_30_Apr_2015.sflb.ashx | title=CNB NEWS RELEASE | publisher=Central Narcotics Bureau (CNB) | date=30 April 2015 | access-date=24 July 2015 | archive-url=https://web.archive.org/web/20150715045305/http://www.cnb.gov.sg/Libraries/CNB_Newsroom_Files/CNB_NR_-_30_Apr_2015.sflb.ashx | archive-date=15 July 2015 | url-status=dead }}
Adverse reactions and deaths
Three people in their 30s were hospitalised after each taking approximately 500 mg of 5-EAPB, one of whom later died in hospital, whilst attending Brownstock music festival in Essex, UK on August 31, 2013.{{cite web | vauthors = Stretch E | date = 1 September 2013 | url = https://www.mirror.co.uk/news/uk-news/brownstock-music-festival-goer-dies-after-2244077 | title = Festivalgoer's death prompts drug warning. | work = The Guardian }}
References
{{Reflist}}
{{Entactogens|state=expanded}}
{{Serotonergics}}
{{Phenethylamines}}
Category:Substituted amphetamines