5-MeO-DPT

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = verified

| Watchedfields = verified

| verifiedrevid = 477224958

| image = 5-MeO-DPT.svg

| width = 220px

| image2 = 5-MeO-DPT.png

| width2 = 220px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| routes_of_administration = Oral

| class = Serotonergic psychedelic; Hallucinogen

| legal_AU =

| legal_CA =

| legal_DE = NpSG

| legal_UK = Class A

| legal_US = Schedule I (isomer of 5-MeO-DIPT)

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| onset = <1 hour

| elimination_half-life =

| duration_of_action = 2–4 hours

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 69496-75-9

| ATC_prefix = None

| ATC_suffix =

| PubChem = 14011047

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 14106484

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 169328

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = AYW60P516B

| synonyms = 5-Methoxy-N,N-dipropyltryptamine

| IUPAC_name = N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-propylpropan-1-amine

| C=17 | H=26 | N=2 | O=1

| SMILES = CCCN(CCC)CCc2c[nH]c1ccc(cc12)OC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H26N2O/c1-4-9-19(10-5-2)11-8-14-13-18-17-7-6-15(20-3)12-16(14)17/h6-7,12-13,18H,4-5,8-11H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PNHPVNBKLQWBKH-UHFFFAOYSA-N

| melting_point = 193

| melting_high = 194

}}

5-MeO-DPT, also known as 5-methoxy-N,N-dipropyltryptamine, is a psychedelic and entheogenic designer drug of the tryptamine family related to dipropyltryptamine (DPT) and 5-MeO-DMT.{{CiteTiHKAL}}{{cite journal | vauthors = Glennon RA, Young R, Rosecrans JA, Kallman MJ | title = Hallucinogenic agents as discriminative stimuli: a correlation with serotonin receptor affinities | journal = Psychopharmacology | volume = 68 | issue = 2 | pages = 155–8 | date = 1980 | pmid = 6776558 | doi = 10.1007/BF00432133 | s2cid = 1674481 }}{{cite journal | vauthors = Nakamoto A, Namera A, Nishida M, Yashiki M, Kuramoto T, Kimura K | title = Identification and quantitative determination of 5-methoxy-N, N-di-n-propyltryptamine in urine by isotope dilution gas chromatography-mass spectrometry. | journal = Forensic Toxicology | date = June 2007 | volume = 25 | issue = 1 | pages = 1–7 | doi = 10.1007/s11419-006-0018-y | s2cid = 9906203 }}{{cite journal | vauthors = Nakazono Y, Tsujikawa K, Kuwayama K, Kanamori T, Iwata YT, Miyamoto K, Kasuya F, Inoue H | title = Simultaneous determination of tryptamine analogues in designer drugs using gas chromatography–mass spectrometry and liquid chromatography–tandem mass spectrometry. | journal = Forensic Toxicology | date = January 2014 | volume = 32 | issue = 1 | pages = 154–61 | doi = 10.1007/s11419-013-0208-3 | s2cid = 25134125 }}{{cite journal | vauthors = Pham DN, Chadeayne AR, Golen JA, Manke DR | title = 5-Meth-oxy-N,N-di-n-propyl-tryptamine (5-MeO-DPT): freebase and fumarate | journal = Acta Crystallographica Section E | volume = 77 | issue = Pt 5 | pages = 522–526 | date = May 2021 | pmid = 34026257 | pmc = 8100262 | doi = 10.1107/S2056989021003753 | bibcode = 2021AcCrE..77..522P }}