6-MAPB

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(Benzofuran-6-yl)-N-methylpropan-2-amine

| image = 6-MAPB.svg

| width = 240

| image2 =

| width2 =

| legal_AU =

| legal_CA = Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| legal_US =

| legal_status =

| dependency_liability =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1354631-79-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4J6PD2FN87

| CAS_supplemental =

| ATCvet =

| PubChem = 122202866

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 32078890

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms =

| C=12 | H=15 | N=1 | O=1

| smiles = CC(NC)CC1=CC(OC=C2)=C2C=C1

| StdInChI = 1S/C12H15NO/c1-9(13-2)7-10-3-4-11-5-6-14-12(11)8-10/h3-6,8-9,13H,7H2,1-2H3

| StdInChIKey = QLAAURQYEAEHBO-UHFFFAOYSA-N

| density =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| specific_rotation =

| sec_combustion =

}}

6-MAPB (1-(benzofuran-6-yl)-N-methylpropan-2-amine) is a psychedelic and entactogenic drug which is structurally related to 6-APB and MDMA.{{cite journal | vauthors = Welter J, Brandt SD, Kavanagh P, Meyer MR, Maurer HH | title = Metabolic fate, mass spectral fragmentation, detectability, and differentiation in urine of the benzofuran designer drugs 6-APB and 6-MAPB in comparison to their 5-isomers using GC-MS and LC-(HR)-MS(n) techniques | journal = Analytical and Bioanalytical Chemistry | volume = 407 | issue = 12 | pages = 3457–3470 | date = May 2015 | pmid = 25711990 | doi = 10.1007/s00216-015-8552-2 | s2cid = 5475974 | url = https://researchonline.ljmu.ac.uk/id/eprint/3412/1/ABC-02336-2014.R1.pdf }}{{cite journal | vauthors = Welter-Luedeke J, Maurer HH | title = New Psychoactive Substances: Chemistry, Pharmacology, Metabolism, and Detectability of Amphetamine Derivatives With Modified Ring Systems | journal = Therapeutic Drug Monitoring | volume = 38 | issue = 1 | pages = 4–11 | date = February 2016 | pmid = 26327309 | doi = 10.1097/FTD.0000000000000240 | s2cid = 20737913 }}{{cite journal | vauthors = Shimshoni JA, Winkler I, Golan E, Nutt D | title = Neurochemical binding profiles of novel indole and benzofuran MDMA analogues | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 390 | issue = 1 | pages = 15–24 | date = January 2017 | pmid = 27650729 | doi = 10.1007/s00210-016-1297-4 | hdl = 10044/1/43622 | s2cid = 253741131 | hdl-access = free }}{{cite journal | vauthors = Brandt SD, Walters HM, Partilla JS, Blough BE, Kavanagh PV, Baumann MH | title = The psychoactive aminoalkylbenzofuran derivatives, 5-APB and 6-APB, mimic the effects of 3,4-methylenedioxyamphetamine (MDA) on monoamine transmission in male rats | journal = Psychopharmacology | volume = 237 | issue = 12 | pages = 3703–3714 | date = December 2020 | pmid = 32875347 | doi = 10.1007/s00213-020-05648-z |pmc=7686291 }} It is not known to have been widely sold as a "designer drug" but has been detected in analytical samples taken from individuals hospitalised after using drug combinations that included other benzofuran derivatives.{{citation needed|date=October 2013}} 6-MAPB was banned in the UK in June 2013, along with 9 other related compounds which were thought to produce similar effects.{{cite web | url = https://www.gov.uk/government/publications/temporary-class-drug-order-report-on-benzofury-and-nbome-compounds | title = Temporary class drug order report on 5-6APB and NBOMe compounds | access-date = 2013-07-10 | date = 4 Jun 2013 | publisher = UK Home Office}}