6-Methylenedihydrodesoxymorphine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477226081

| IUPAC_name = 4,5-α-Epoxy-17-methyl-6-methylenemorphinan-3-ol

| image = 6-Methylenedihydrodesoxymorphine.svg

| image_class = skin-invert-image

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 3414-84-4

| ATC_prefix =

| ATC_suffix =

| PubChem = 5492874

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4591200

| C=18 | H=21 | N=1 | O=2

| smiles = Oc2c1O[C@H]5\C(=C)CC[C@H]4[C@@H]3N(CC[C@@]45c1c(cc2)C3)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H21NO2/c1-10-3-5-12-13-9-11-4-6-14(20)16-15(11)18(12,17(10)21-16)7-8-19(13)2/h4,6,12-13,17,20H,1,3,5,7-9H2,2H3/t12-,13+,17-,18-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LBCZKDPFDXFDTN-GGNLRSJOSA-N

| synonyms = 6-MDDM, 6-Methylene- dihydrodesoxymorphine

}}

6-Methylenedihydrodesoxymorphine (6-MDDM) is an opiate analogue structurally related to desomorphine that is a derivative of hydromorphone, where the 6-ketone group has been replaced by a methylidene group. It has sedative and analgesic effects.

6-Methylenedihydrodesoxymorphine is a potent μ-opioid agonist, 80x stronger than morphine.{{cite web | vauthors = Woster PM | url = http://www.acsmedchem.org/module/opioid.html | title = Chemistry of Opioid Analgesics | work = PHA 4220 - Neurology Pharmacotherapeutics, Medicinal Chemistry Tutorials | archive-url = https://web.archive.org/web/20070716115228/http://www.acsmedchem.org/module/opioid.html | archive-date=July 16, 2007 }} Compared to morphine it has a faster onset of action and similar duration of effects.{{cite journal | vauthors = Abdel-Rahman MA, Elliott HW, Binks R, Küng W, Rapoport H | title = Synthesis and pharmacology of 6-methylenedihydrodesoxymorphine | journal = Journal of Medicinal Chemistry | volume = 9 | issue = 1 | pages = 1–6 | date = January 1966 | pmid = 4163617 | doi = 10.1021/jm00319a001 }} It produces around the same degree of respiratory depression as morphine, but less inhibition of gastrointestinal motility. Animal studies show it to be a potent analgesic which produces significant analgesic effects even at low doses while inducing comparatively few side effects,{{cite journal | vauthors = Okun R, Elliott HW | title = Acute pharmacological studies of some new morphine derivatives | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 124 | issue = 3 | pages = 255–9 | date = November 1958 | pmid = 13588539 }} however it has never been developed for medical use in humans. Its synthesis typically takes 12 hours to a day.

6-Methylenedihydrodesoxymorphine is synthesised in two steps; first a Wittig reaction is used, reacting hydrocodone with methylenetriphenylphosphorane and an alkyl lithium reagent in diethyl ether to form 6-Methylenedihydrodesoxycodeine. The 3-methoxy group is then cleaved to hydroxy, by reaction with pyridine. The second step tends to be incomplete and often gives fairly low yields, but these can be improved by changing the reaction conditions.{{cite journal | vauthors = Chadha MS, Rapoport H | title = The Preparation of Some 6-Methylated Dihydrodesoxymorphines. | journal = Journal of the American Chemical Society | date = 1957 | volume = 79 | issue = 21 | pages = 5730–5734 | doi = 10.1021/ja01578a040 }}{{cite journal | vauthors = Wiegert PE, De La Mater G, McElheny GC, Patterson LA | title = Physical Constants of 6-Methylenedihydrodesoxymorphine. | journal = Journal of Organic Chemistry | date = 1961 | volume = 26 | issue = 12 | pages = 5249–5250 | doi = 10.1021/jo01070a541 }}

See also

References

{{Reflist|2}}

{{Opioidergics}}

{{DEFAULTSORT:Methylenedihydrodesoxymorphine, 6-}}

Category:4,5-Epoxymorphinans

Category:Mu-opioid receptor agonists

Category:Hydroxyarenes

Category:Semisynthetic opioids