7β-Hydroxyepiandrosterone

{{Chembox

| ImageFile = 7β-Hydroxyepiandrosterone.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 3β,7β-Dihydroxy-5α-androstan-17-one

| SystematicName = (3aS,3bR,4S,5aR,7S,9aS,9bS,11aS)-4,7-Dihydroxy-9a,11a-dihydroxyhexadecahydro-1H-cyclopenta[a]phenanthren-1-one

| OtherNames = 7β-OH-EPIA; 5α-Androstan-3β,7β-diol-17-one

| Section1 = {{Chembox Identifiers

| CASNo = 25848-69-5

| ChemSpiderID = 8011902

| ChEBI = 183809

| PubChem = 9836181

| StdInChI = 1S/C19H30O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h11-15,17,20-21H,3-10H2,1-2H3/t11-,12+,13+,14+,15+,17+,18+,19+/m1/s1

| StdInChIKey = VFPMCLQMAUVEHD-UCPSWNCLSA-N

| SMILES = C[C@]12CC[C@@H](C[C@@H]1C[C@@H]([C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O)O

| UNII = OCP3E5KD08

}}

| Section2 = {{Chembox Properties

| C=19 | H=30 | O=3

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

7β-Hydroxyepiandrosterone (7β-OH-EPIA), also known as 5α-androstan-3β,7β-diol-17-one, is an endogenous androgen, estrogen, and neurosteroid that is produced from dehydroepiandrosterone and epiandrosterone.{{cite journal | vauthors = Dudas B, Hanin I, Rose M, Wülfert E | title = Protection against inflammatory neurodegeneration and glial cell death by 7beta-hydroxy epiandrosterone, a novel neurosteroid | journal = Neurobiol. Dis. | volume = 15 | issue = 2 | pages = 262–8 | year = 2004 | pmid = 15006696 | doi = 10.1016/j.nbd.2003.11.001 | s2cid = 24078411 }}{{cite journal | vauthors = Sandra N, Ester P, Marie-Agnès P, Robert M, Olivier H | title = The DHEA metabolite 7β-hydroxy-epiandrosterone exerts anti-estrogenic effects on breast cancer cell lines | journal = Steroids | volume = 77 | issue = 5 | pages = 542–51 | year = 2012 | pmid = 22342541 | doi = 10.1016/j.steroids.2012.01.019 | s2cid = 140140008 | url =https://tel.archives-ouvertes.fr/tel-00727277/file/ThA_se_-_Sandra_-_NIRO.pdf }}{{cite journal | vauthors = Miller KK, Al-Rayyan N, Ivanova MM, Mattingly KA, Ripp SL, Klinge CM, Prough RA | title = DHEA metabolites activate estrogen receptors alpha and beta | journal = Steroids | volume = 78 | issue = 1 | pages = 15–25 | year = 2013 | pmid = 23123738 | pmc = 3529809 | doi = 10.1016/j.steroids.2012.10.002 }} It has neuroprotective effects and, along with 7α-hydroxyepiandrosterone, may mediate the neuroprotective effects of DHEA. 7β-OH-EPIA may act as a highly potent antagonist of the G protein-coupled estrogen receptor (GPER) (affinity of <1 nM).{{cite journal | vauthors = Prossnitz ER, Arterburn JB | title = International Union of Basic and Clinical Pharmacology. XCVII. G Protein-Coupled Estrogen Receptor and Its Pharmacologic Modulators | journal = Pharmacol. Rev. | volume = 67 | issue = 3 | pages = 505–40 | date = July 2015 | pmid = 26023144 | pmc = 4485017 | doi = 10.1124/pr.114.009712 }}