7-ACA

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477226392

| Name = 7-Aminocephalosporanic acid

| ImageFile = 7-ACA.svg

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageSize = 244

| ImageName = Partially condensed, stereo, skeletal formula of 7-aminocephalosporanic acid

| ImageFile2 = 7-ACA-3D-balls.png

| IUPACName = 3-[(Acetyloxy)methyl]-7β-amino-3,4-didehydrocepham-4-carboxylic acid

| SystematicName = (6R,7R)-3-[(Acetyloxy)methyl]-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| OtherNames = 7-Aminocephalosporinic acid

|Section1={{Chembox Identifiers

| Abbreviations = 7-ACA

| CASNo = 957-68-6

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9XI67897RG

| PubChem = 483168

| ChemSpiderID = 390087

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| EINECS = 213-485-0

| KEGG = C07756

| KEGG_Ref = {{keggcite|correct|kegg}}

| MeSHName = 7-Aminocephalosporanic+acid

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 2255

| ChEMBL = 1161449

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| Beilstein = 622637, 8919572

| 3DMet = B02205

| SMILES = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2N)COC(=O)C)C(=O)O

| StdInChI = 1S/C10H12N2O5S/c1-4(13)17-2-5-3-18-9-6(11)8(14)12(9)7(5)10(15)16/h6,9H,2-3,11H2,1H3,(H,15,16)/t6-,9-/m1/s1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HSHGZXNAXBPPDL-HZGVNTEJSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

}}

|Section2={{Chembox Properties

| C=10 | H=12 | N=2 | S=1 | O=5

| MeltingPtC = 300

| MeltingPt_ref = [http://www.chemblink.com/products/957-68-6.htm 7-ACA at Chemblink]

| LogP = −1.87

| pKa = 2.59

| pKb = 11.41

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS health hazard}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|317|334}}

| PPhrases = {{P-phrases|261|280|342+311}}

}}

}}

7-ACA (7-aminocephalosporanic acid) is the core chemical structure (a synthon) for the synthesis of cephalosporin antibiotics and intermediates. It can be obtained by chemoenzymatic hydrolysis of cephalosporin C.{{cite journal | journal = World Journal of Microbiology & Biotechnology | volume = 26 | issue = 1 | pages = 145–152 | year = 2010 | doi = 10.1007/s11274-009-0153-9 | title = Single-pot conversion of cephalosporin C to 7-aminocephalosporanic acid in the absence of hydrogen peroxide | last1 = Tan | first1 = Qiang | last2 = Zhang | first2 = Yewang | last3 = Song | first3 = Qingxun | last4 = Wei | first4 = Dongzhi| s2cid = 84749385 }}{{cite journal | journal = Enzyme and Microbial Technology | volume = 39 | issue = 5 | pages = 1166–1172 | year = 2006 | doi = 10.1016/j.enzmictec.2006.02.028 | title = Single-pot conversion of cephalosporin C to 7-aminocephalosporanic acid using cell-bound and support-bound enzymes | last1 = Tan | first1 = Qiang | last2 = Song | first2 = Qingxun | last3 = Wei | first3 = Dongzhi}}

The production of 7-ACA (7-aminocephalosporanic acid) is predominantly segmented into two methods which is Enzymatic Hydrolysis and Chemical Cracking. These processes are essential for the synthesis of various cephalosporin antibiotics.{{cite web |title=7-Aminocephalosporanic Acid (7-ACA) Market |url=https://marketsglob.com/report/7-aminocephalosporanic-acid-7-aca-market/9298/ |website=Markets Glob Market Research |access-date=30 August 2024}}