7-Chloro-AMT
{{Short description|Chemical compound}}
{{drugbox
| drug_name = 7-Chloro-AMT
| image = 7-Chloro-AMT.svg
| legal_UK =
| legal_DE =
| C = 11 | H = 13 | Cl = 1 | N = 2
| IUPAC_name = 1-(7-chloro-1H-indol-3-yl)propan-2-amine
| CAS_number = 711-99-9
| CAS_number_Ref = {{cascite|correct|CAS}}
| ChEMBL =
| ChemSpiderID = 13298
| PubChem = 13900
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = J4Y6BPR38T
| smiles = CC(CC1=CNC2=C1C=CC=C2Cl)N
| StdInChI = 1S/C11H13ClN2/c1-7(13)5-8-6-14-11-9(8)3-2-4-10(11)12/h2-4,6-7,14H,5,13H2,1H3
| StdInChIKey = OHEYTFPYHFDAJQ-UHFFFAOYSA-N
}}
7-Chloro-α-methyltryptamine (7-Cl-AMT) is a tryptamine derivative with stimulant effects, invented in the 1960s. It is a weak monoamine oxidase inhibitor but its pharmacology has not otherwise been studied by modern techniques, though several closely related compounds are known to act as serotonin–dopamine releasing agents and agonists of the 5-HT2A receptor.{{cite patent | inventor = Hofmann A, Troxler F | title = New indole derivatives and their preparation | country = FR | number = 1344579 | pubdate = 29 November 1963 | assign1 = Sandoz SA | postscript = . }}{{cite patent | inventor = Robert VJ, Jackson HO | title = 7-Chloro-alpha-methyltryptamine derivatives. | country = US | number = 3282959 | gdate = 1 November 1966 | assign1 = Parke-Davis | postscript = . }}{{cite journal | vauthors = Blough BE, Landavazo A, Partilla JS, Decker AM, Page KM, Baumann MH, Rothman RB | title = Alpha-ethyltryptamines as dual dopamine-serotonin releasers | journal = Bioorganic & Medicinal Chemistry Letters | volume = 24 | issue = 19 | pages = 4754–4758 | date = October 2014 | pmid = 25193229 | pmc = 4211607 | doi = 10.1016/j.bmcl.2014.07.062 }}
See also
References
{{reflist}}
{{Serotonergics}}
{{Tryptamines}}
Category:Alpha-Alkyltryptamines
Category:Serotonin receptor agonists
{{nervous-system-drug-stub}}