8-OH-PBZI

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 477227292

| IUPAC_name = (3aS,9bR)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-8-ol

| image = 8-OH-PBZI Structure.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 251327-33-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = B8GYQ9JV5F

| ATC_prefix = none

| ATC_suffix =

| PubChem = 10353845

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8529297

| C=15 | H=21 | N=1 | O=1

| smiles = CCCN1CC[C@H]2[C@@H]1CCC3=C2C=C(C=C3)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H21NO/c1-2-8-16-9-7-13-14-10-12(17)5-3-11(14)4-6-15(13)16/h3,5,10,13,15,17H,2,4,6-9H2,1H3/t13-,15+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LJDRQPOQHHOXHM-HIFRSBDPSA-N

}}

8-OH-PBZI is a drug used in scientific research which acts as a potent and selective agonist for the dopamine D₃ receptor.{{cite journal | vauthors = Scheideler MA, Martin J, Hohlweg R, Rasmussen JS, Naerum L, Ludvigsen TS, Larsen PJ, Korsgaard N, Crider AM, Ghosh D, Cruse SF, Fink-Jensen A | display-authors = 6 | title = The preferential dopamine D3 receptor agonist cis-8-OH-PBZI induces limbic Fos expression in rat brain | journal = European Journal of Pharmacology | volume = 339 | issue = 2–3 | pages = 261–70 | date = November 1997 | pmid = 9473144 | doi = 10.1016/S0014-2999(97)01372-1 }}{{cite journal | vauthors = Fink-Jensen A, Nielsen EB, Hansen L, Scheideler MA | title = Behavioral and neurochemical effects of the preferential dopamine D3 receptor agonist cis-8-OH-PBZI | journal = European Journal of Pharmacology | volume = 342 | issue = 2–3 | pages = 153–61 | date = January 1998 | pmid = 9548380 | doi = 10.1016/S0014-2999(97)01494-5 }}{{cite journal | vauthors = Malik P, Andersen MB, Peacock L | title = The effects of dopamine D3 agonists and antagonists in a nonhuman primate model of tardive dyskinesia | journal = Pharmacology, Biochemistry, and Behavior | volume = 78 | issue = 4 | pages = 805–10 | date = August 2004 | pmid = 15301939 | doi = 10.1016/j.pbb.2004.05.019 | s2cid = 19410897 }}