ADB-HEXINACA

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-hexyl-1H-indazole-3-carboxamide

| image = ADB-HEXINACA_structure.png

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule II

| legal_DE = NpSG

| legal_UK = Class B

| legal_US = Schedule I

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3047777-38-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII =

| ATC_prefix =

| ATC_suffix =

| PubChem = 163191674

| ChemSpiderID = 109107958

| smiles = O=C(N[C@@H](C(C)(C)C)C(N)=O)C1=NN(CCCCCC)C2=C1C=CC=C2

| StdInChI = 1S/C20H30N4O2/c1-5-6-7-10-13-24-15-12-9-8-11-14(15)16(23-24)19(26)22-17(18(21)25)20(2,3)4/h8-9,11-12,17H,5-7,10,13H2,1-4H3,(H2,21,25)(H,22,26)/t17-/m1/s1

| StdInChIKey = PZMLDAGKYPJWHJ-QGZVFWFLSA-N

| C=20 | H=30 | N=4 | O=2

}}

ADB-HEXINACA (also known as ADB-HINACA and ADMB-HEXINACA) is a cannabinoid designer drug that has been found as an ingredient in some synthetic cannabis products, first appearing in early 2021. It is a longer chain homologue of previously encountered synthetic cannabinoid compounds such as ADB-BUTINACA and ADB-PINACA.{{cite journal | vauthors = Kronstrand R, Norman C, Vikingsson S, Biemans A, Valencia Crespo B, Edwards D, Fletcher D, Gilbert N, Persson M, Reid R, Semenova O, Al Teneiji F, Wu X, Dahlén J, NicDaéid N, Tarbah F, Sutcliffe OB, McKenzie C, Gréen H | display-authors = 6 | title = The metabolism of the synthetic cannabinoids ADB-BUTINACA and ADB-4en-PINACA and their detection in forensic toxicology casework and infused papers seized in prisons | journal = Drug Testing and Analysis | date = November 2021 | volume = 14 | issue = 4 | pages = 634–652 | pmid = 34811926 | doi = 10.1002/dta.3203 | s2cid = 244490343 | url = https://discovery.dundee.ac.uk/en/publications/a9c83a12-49d4-4b09-8f08-83bac57bcc24 | doi-access = free }}{{cite journal | vauthors = Gilbert N, Costello A, Ellison JR, Khan U, Knight M, Linnell MJ, Ralphs R, Mewis RE, Sutcliffe OB | display-authors = 6 | title = Synthesis, characterisation, detection and quantification of a novel hexyl-substituted synthetic cannabinoid receptor agonist: (S)-N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-hexyl-1H-indazole-3-carboxamide (ADB-HINACA). | journal = Forensic Chemistry | date = December 2021 | volume = 26 | pages = 100354 | doi =10.1016/j.forc.2021.100354 | url = https://e-space.mmu.ac.uk/628354/3/Gilbert_ADBHINACA_R2.pdf }} The pharmacology of ADB-HEXINACA and numerous analogues at CB1 and CB2 receptors has been reported.{{cite journal | vauthors = Sparkes E, Timmerman A, Markham JW, Boyd R, Gordon R, Walker KA, Kevin RC, Hibbs DE, Banister SD, Cairns EA, Stove C, Ametovski A | display-authors = 6 | title = Synthesis and Functional Evaluation of Synthetic Cannabinoid Receptor Agonists Related to ADB-HEXINACA | journal = ACS Chemical Neuroscience | date = April 2024 | volume = 15| issue = 9| pages = 1787–1812| pmid = 38597712| doi = 10.1021/acschemneuro.3c00818 | s2cid = | url = https://pubs.acs.org/doi/10.1021/acschemneuro.3c00818 | doi-access = | url-access = subscription }}

See also

References