AL-37350A

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477346561

| IUPAC_name = (S)-(+)-1-(2-Aminopropyl)-8,9-dihydropyrano[3,2-e]indole

| image = AL-37350A Structure.svg

| width = 140

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 362603-40-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KT54N4CC67

| ATC_prefix =

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 133455

| PubChem = 10331436

| IUPHAR_ligand = 160

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8506896

| C=14 | H=18 | N=2 | O=1

| smiles = O2c1ccc3c(c1CCC2)c(c[nH]3)C[C@@H](N)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H18N2O/c1-9(15)7-10-8-16-12-4-5-13-11(14(10)12)3-2-6-17-13/h4-5,8-9,16H,2-3,6-7,15H2,1H3/t9-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VVHJUSGIUWQPIT-VIFPVBQESA-N

| melting_point =

| melting_high =

}}

AL-37350A (4,5-DHP-AMT) is a tricyclic tryptamine derivative which acts as a potent and selective agonist for the serotonin receptor 5-HT_2A, with a Ki of 2.0 nM, and moderate selectivity over the related 5-HT_2B and 5-HT_2C receptors. It has been shown to have ocular hypotensive activity in animal models, suggesting it may be useful for the treatment of glaucoma.{{cite journal |vauthors =May JA, Chen HH, Rusinko A, Lynch VM, Sharif NA, McLaughlin MA |title=A novel and selective 5-HT2 receptor agonist with ocular hypotensive activity: (S)-(+)-1-(2-aminopropyl)-8,9-dihydropyrano[3,2-e]indole |journal=Journal of Medicinal Chemistry |volume=46 |issue=19 |pages=4188–95 |date=September 2003 |pmid=12954071 |doi=10.1021/jm030205t |citeseerx=10.1.1.688.6169 }}