AL-37350A
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477346561
| IUPAC_name = (S)-(+)-1-(2-Aminopropyl)-8,9-dihydropyrano[3,2-e]indole
| image = AL-37350A Structure.svg
| width = 140
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 362603-40-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = KT54N4CC67
| ATC_prefix =
| ATC_suffix =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 133455
| PubChem = 10331436
| IUPHAR_ligand = 160
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8506896
| C=14 | H=18 | N=2 | O=1
| smiles = O2c1ccc3c(c1CCC2)c(c[nH]3)C[C@@H](N)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H18N2O/c1-9(15)7-10-8-16-12-4-5-13-11(14(10)12)3-2-6-17-13/h4-5,8-9,16H,2-3,6-7,15H2,1H3/t9-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VVHJUSGIUWQPIT-VIFPVBQESA-N
| melting_point =
| melting_high =
}}
AL-37350A (4,5-DHP-AMT) is a tricyclic tryptamine derivative which acts as a potent and selective agonist for the serotonin receptor 5-HT2A, with a Ki of 2.0 nM, and moderate selectivity over the related 5-HT2B and 5-HT2C receptors. It has been shown to have ocular hypotensive activity in animal models, suggesting it may be useful for the treatment of glaucoma.{{cite journal |vauthors =May JA, Chen HH, Rusinko A, Lynch VM, Sharif NA, McLaughlin MA |title=A novel and selective 5-HT2 receptor agonist with ocular hypotensive activity: (S)-(+)-1-(2-aminopropyl)-8,9-dihydropyrano[3,2-e]indole |journal=Journal of Medicinal Chemistry |volume=46 |issue=19 |pages=4188–95 |date=September 2003 |pmid=12954071 |doi=10.1021/jm030205t |citeseerx=10.1.1.688.6169 }}
See also
References
{{reflist}}
{{Serotonergics}}
{{Tryptamines}}
Category:Alpha-Alkyltryptamines
Category:Serotonin receptor agonists
{{nervous-system-drug-stub}}