AM-087
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 477346628
| IUPAC_name = (6aR,10aR)-3-(2-Methyl-6-bromohex-2-yl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol
| image = AM-087.svg
| image_class = skin-invert-image
| width = 240
| tradename =
| legal_status =
| routes_of_administration =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 152674-96-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = B4C266FTR4
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 199561
| PubChem = 10717065
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8892405
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H33BrO2/c1-15-8-9-18-17(12-15)21-19(25)13-16(14-20(21)26-23(18,4)5)22(2,3)10-6-7-11-24/h8,13-14,17-18,25H,6-7,9-12H2,1-5H3/t17-,18-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RJPGJHLVEUSRRA-QZTJIDSGSA-N
| C=23 | H=33 | Br=1 | O=2
| smiles = CC3(C)C1CC=C(C)CC1c2c(O)cc(C(C)(C)CCCCBr)cc2O3
}}
AM-087 (part of the AM cannabinoid series) is an analgesic drug which acts as a cannabinoid agonist.{{cite journal | vauthors = Martin BR, Compton DR, Semus SF, Lin S, Marciniak G, Grzybowska J, Charalambous A, Makriyannis A | display-authors = 6 | title = Pharmacological evaluation of iodo and nitro analogs of Δ8-THC and Δ9-THC | journal = Pharmacology, Biochemistry, and Behavior | volume = 46 | issue = 2 | pages = 295–301 | date = October 1993 | pmid = 8265683 | doi = 10.1016/0091-3057(93)90356-X | s2cid = 140209578 }} It is a derivative of Δ8-THC, substituted on the 3-position side chain. AM-087 is a potent CB1 agonist with a Ki of 0.43 nM, making it around 100 times more potent than THC itself. This is most likely due to the bulky bromine substituent on the side chain.{{cite journal | vauthors = Charalambous A, Lin S, Marciniak G, Banijamali A, Friend FL, Compton DR, Martin BR, Makriyannis A | display-authors = 6 | title = Pharmacological evaluation of halogenated delta 8-THC analogs | journal = Pharmacology, Biochemistry, and Behavior | volume = 40 | issue = 3 | pages = 509–12 | date = November 1991 | pmid = 1666915 | doi = 10.1016/0091-3057(91)90355-6 | s2cid = 140209927 }}
See also
References
{{reflist}}
{{cannabinoids}}
{{cannabinoid-stub}}