AM-0902

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-({3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl}methyl)-7-methylpurin-6-one

| image = AM-0902 Structure.svg

| width = 220

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1883711-97-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3E4SQ96PCJ

| PubChem = 73297271

| ChemSpiderID = 58864849

| ChEMBL = 3785736

| C=17 | H=15 | Cl=1 | N=6 | O=2

| smiles = CN1C=NC2=C1C(=O)N(C=N2)CC3=NC(=NO3)CCC4=CC=C(C=C4)Cl

| StdInChI = 1S/C17H15ClN6O2/c1-23-9-19-16-15(23)17(25)24(10-20-16)8-14-21-13(22-26-14)7-4-11-2-5-12(18)6-3-11/h2-3,5-6,9-10H,4,7-8H2,1H3

| StdInChIKey = AWJBWNUUODWOKQ-UHFFFAOYSA-N

}}

AM-0902 is a drug which acts as a potent and selective antagonist for the TRPA1 receptor, and has analgesic and antiinflammatory effects.{{cite journal | vauthors = Schenkel LB, Olivieri PR, Boezio AA, Deak HL, Emkey R, Graceffa RF, Gunaydin H, Guzman-Perez A, Lee JH, Teffera Y, Wang W, Youngblood BD, Yu VL, Zhang M, Gavva NR, Lehto SG, Geuns-Meyer S | display-authors = 6 | title = Optimization of a Novel Quinazolinone-Based Series of Transient Receptor Potential A1 (TRPA1) Antagonists Demonstrating Potent in Vivo Activity | journal = Journal of Medicinal Chemistry | volume = 59 | issue = 6 | pages = 2794–809 | date = March 2016 | pmid = 26942860 | doi = 10.1021/acs.jmedchem.6b00039 }}{{cite journal | vauthors = Huang Y, Chen SR, Chen H, Pan HL | title = Endogenous transient receptor potential ankyrin 1 and vanilloid 1 activity potentiates glutamatergic input to spinal lamina I neurons in inflammatory pain | journal = Journal of Neurochemistry | volume = 149 | issue = 3 | pages = 381–398 | date = May 2019 | pmid = 30716174 | doi = 10.1111/jnc.14677 | pmc = 6483867 }}