ART26.12
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| IUPAC_name = (2R,4R)-3-(2,3-dihydro-1H-inden-2-yloxycarbonyl)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid
| image = ART26.12.svg
| tradename =
| pregnancy_category =
| legal_CA =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 2766800-24-0
| ATC_prefix =
| ATC_suffix =
| UNII =
| PubChem = 163249803
| C=29 | H=28 | O=6
| smiles = COC1=CC=CC=C1[C@@H]2C([C@H](C2C(=O)OC3CC4=CC=CC=C4C3)C5=CC=CC=C5OC)C(=O)O
| StdInChI = 1S/C29H28O6/c1-33-22-13-7-5-11-20(22)24-26(28(30)31)25(21-12-6-8-14-23(21)34-2)27(24)29(32)35-19-15-17-9-3-4-10-18(17)16-19/h3-14,19,24-27H,15-16H2,1-2H3,(H,30,31)/t24-,25-,26?,27?/m1/s1
| StdInChIKey = HFKXLDACQCGGEI-BINWOUKTSA-N
}}
ART26.12 is an experimental drug that acts as a selective inhibitor of the enzyme FABP5, which usually breaks down endocannabinoids such as anandamide. ART26.12 thereby boosts endocannabinoid levels and has analgesic effects, showing efficacy against atypical pain syndromes such as hyperalgesia and allodynia. It is being researched as a potential treatment for neuropathy which can occur as a side effect of some kinds of chemotherapy, as well as showing activity against psoriasis.{{cite journal | vauthors = Warren G, Osborn M, Tsantoulas C, David-Pereira A, Cohn D, Duffy P, Ruston L, Johnson C, Bradshaw H, Kaczocha M, Ojima I, Yates A, O'Sullivan SE | title = Discovery and Preclinical Evaluation of a Novel Inhibitor of FABP5, ART26.12, Effective in Oxaliplatin-Induced Peripheral Neuropathy | journal = The Journal of Pain | volume = 25 | issue = 7 | pages = 104470 | date = July 2024 | pmid = 38232863 | doi = 10.1016/j.jpain.2024.01.335 | doi-access = free }}{{cite journal | vauthors = Warren WG, Osborn M, Duffy P, Yates A, O'Sullivan SE | title = Potential safety implications of fatty acid-binding protein inhibition | journal = Toxicology and Applied Pharmacology | volume = 491 | pages = 117079 | date = October 2024 | pmid = 39218163 | doi = 10.1016/j.taap.2024.117079 | bibcode = 2024ToxAP.49117079W | doi-access = free }}{{cite journal | vauthors = Warren WG, Osborn M, David-Pereira A, Tsantoulas C, Xue W, Yates A, OSullivan SE | title = ART26.12, a novel fatty acid-binding protein 5 inhibitor, shows efficacy in multiple preclinical neuropathy models | journal = European Journal of Pain | location = London, England | volume = 29 | issue = 2 | pages = e4718 | date = February 2025 | pmid = 39188040 | pmc = 11671339 | doi = 10.1002/ejp.4718 }}{{cite journal | vauthors = Warren WG, Osborn M, Yates A, O'Sullivan SE | title = ART26.12, a fatty acid-binding protein 5 inhibitor, shows efficacy in preclinical psoriasis models. | journal = The Journal of Investigative Dermatology | date = April 2025 | pmid = 40210114 | doi = 10.1016/j.jid.2025.03.026 }}
References
{{reflist}}
{{Cannabinoids}}
{{cannabinoid-stub}}