ASP-7663

{{Chembox

| ImageFile = ASP-7663_structure.png

| ImageSize = 200px

| ImageAlt =

| PIN = (E)-[7-Fluoro-1-(2-methylpropyl)-2-oxo-1,2-dihydro-3H-indol-3-ylidene]acetic acid

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 1190217-35-6

| PubChem = 44232532

| SMILES = CC(C)CN1C2=C(C=CC=C2F)/C(=C\C(=O)O)/C1=O

| ChemSpiderID = 24676635

| ChEMBL = 1082283

| InChI = 1S/C14H14FNO3/c1-8(2)7-16-13-9(4-3-5-11(13)15)10(14(16)19)6-12(17)18/h3-6,8H,7H2,1-2H3,(H,17,18)/b10-6+

| InChIKey = RCVZUIGCNAAMIC-UXBLZVDNSA-N }}

|Section2={{Chembox Properties

| C=14 | H=14 | F=1 | N=1 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

ASP-7663 is a chemical compound which acts as a potent, selective activator of the TRPA1 channel. It has protective effects on cardiac tissue, and is used for research into the function of the TRPA1 receptor.{{cite journal | vauthors = Pan Y, Zhao G, Cai Z, Chen F, Xu D, Huang S, Lan H, Tong Y | display-authors = 6 | title = Synergistic Effect of Ferulic Acid and Z-Ligustilide, Major Components of A. sinensis, on Regulating Cold-Sensing Protein TRPM8 and TPRA1 In Vitro | journal = Evidence-Based Complementary and Alternative Medicine | year = 2016 | volume = 2016 | pages = 3160247 | pmid = 27413384 | doi = 10.1155/2016/3160247 | pmc = 4931054 | s2cid = 14007898 | doi-access = free }}{{cite journal | vauthors = Lu Y, Piplani H, McAllister SL, Hurt CM, Gross ER | title = Transient Receptor Potential Ankyrin 1 Activation within the Cardiac Myocyte Limits Ischemia-reperfusion Injury in Rodents | journal = Anesthesiology | volume = 125 | issue = 6 | pages = 1171–1180 | date = December 2016 | pmid = 27748654 | doi = 10.1097/ALN.0000000000001377 | pmc = 5110384 }}