ATC-0175

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 477236709

| IUPAC_name = N-[cis-4-([4-(dimethylamino)quinazolin-2-yl]amino)cyclohexyl]-3,4-difluorobenzamide

| image = ATC-0175_structure.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 1305

| CAS_number = 509118-03-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 539503G9M0

| ATC_prefix =

| ATC_suffix =

| PubChem = 9934033

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8109661

| C=23 | H=25 | F=2 | N=5 | O=1

| smiles = Fc1ccc(cc1F)C(=O)NC3CCC(CC3)Nc(nc4N(C)C)nc2ccccc24

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H25F2N5O/c1-30(2)21-17-5-3-4-6-20(17)28-23(29-21)27-16-10-8-15(9-11-16)26-22(31)14-7-12-18(24)19(25)13-14/h3-7,12-13,15-16H,8-11H2,1-2H3,(H,26,31)(H,27,28,29)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FAIMGWSOSCFGRU-UHFFFAOYSA-N

}}

ATC-0175 is a drug used in scientific research, which is a selective, non-peptide antagonist at the melanin concentrating hormone receptor MCH1. In animal studies it has been shown to produce both anxiolytic and antidepressant actions, but without sedative or ataxic side effects.{{cite journal |vauthors=Chaki S, Funakoshi T, Hirota-Okuno S, Nishiguchi M, Shimazaki T, Iijima M, Grottick AJ, Kanuma K, Omodera K, Sekiguchi Y, Okuyama S, Tran TA, Semple G, Thomsen W |title=Anxiolytic- and antidepressant-like profile of ATC0065 and ATC0175: nonpeptidic and orally active melanin-concentrating hormone receptor 1 antagonists |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=313 |issue=2 |pages=831–9 |date=May 2005 |pmid=15677346 |doi=10.1124/jpet.104.081711 |s2cid=23023526 }}{{cite journal |vauthors=Kanuma K, Omodera K, Nishiguchi M, Funakoshi T, Chaki S, Semple G, Tran TA, Kramer B, Hsu D, Casper M, Thomsen B, Sekiguchi Y |title=Lead optimization of 4-(dimethylamino)quinazolines, potent and selective antagonists for the melanin-concentrating hormone receptor 1 |journal=Bioorganic & Medicinal Chemistry Letters |volume=15 |issue=17 |pages=3853–6 |date=September 2005 |pmid=16002290 |doi=10.1016/j.bmcl.2005.05.121 }}{{cite journal |vauthors=Chaki S, Yamaguchi J, Yamada H, Thomsen W, Tran TA, Semple G, Sekiguchi Y |title=ATC0175: an orally active melanin-concentrating hormone receptor 1 antagonist for the potential treatment of depression and anxiety |journal=CNS Drug Reviews |volume=11 |issue=4 |pages=341–52 |year=2005 |pmid=16614734 |doi= 10.1111/j.1527-3458.2005.tb00052.x|pmc=6741758 }}

References