ATC-0175
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 477236709
| IUPAC_name = N-[cis-4-([4-(dimethylamino)quinazolin-2-yl]amino)cyclohexyl]-3,4-difluorobenzamide
| image = ATC-0175_structure.png
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| IUPHAR_ligand = 1305
| CAS_number = 509118-03-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 539503G9M0
| ATC_prefix =
| ATC_suffix =
| PubChem = 9934033
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8109661
| C=23 | H=25 | F=2 | N=5 | O=1
| smiles = Fc1ccc(cc1F)C(=O)NC3CCC(CC3)Nc(nc4N(C)C)nc2ccccc24
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H25F2N5O/c1-30(2)21-17-5-3-4-6-20(17)28-23(29-21)27-16-10-8-15(9-11-16)26-22(31)14-7-12-18(24)19(25)13-14/h3-7,12-13,15-16H,8-11H2,1-2H3,(H,26,31)(H,27,28,29)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FAIMGWSOSCFGRU-UHFFFAOYSA-N
}}
ATC-0175 is a drug used in scientific research, which is a selective, non-peptide antagonist at the melanin concentrating hormone receptor MCH1. In animal studies it has been shown to produce both anxiolytic and antidepressant actions, but without sedative or ataxic side effects.{{cite journal |vauthors=Chaki S, Funakoshi T, Hirota-Okuno S, Nishiguchi M, Shimazaki T, Iijima M, Grottick AJ, Kanuma K, Omodera K, Sekiguchi Y, Okuyama S, Tran TA, Semple G, Thomsen W |title=Anxiolytic- and antidepressant-like profile of ATC0065 and ATC0175: nonpeptidic and orally active melanin-concentrating hormone receptor 1 antagonists |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=313 |issue=2 |pages=831–9 |date=May 2005 |pmid=15677346 |doi=10.1124/jpet.104.081711 |s2cid=23023526 }}{{cite journal |vauthors=Kanuma K, Omodera K, Nishiguchi M, Funakoshi T, Chaki S, Semple G, Tran TA, Kramer B, Hsu D, Casper M, Thomsen B, Sekiguchi Y |title=Lead optimization of 4-(dimethylamino)quinazolines, potent and selective antagonists for the melanin-concentrating hormone receptor 1 |journal=Bioorganic & Medicinal Chemistry Letters |volume=15 |issue=17 |pages=3853–6 |date=September 2005 |pmid=16002290 |doi=10.1016/j.bmcl.2005.05.121 }}{{cite journal |vauthors=Chaki S, Yamaguchi J, Yamada H, Thomsen W, Tran TA, Semple G, Sekiguchi Y |title=ATC0175: an orally active melanin-concentrating hormone receptor 1 antagonist for the potential treatment of depression and anxiety |journal=CNS Drug Reviews |volume=11 |issue=4 |pages=341–52 |year=2005 |pmid=16614734 |doi= 10.1111/j.1527-3458.2005.tb00052.x|pmc=6741758 }}