ATL-444
{{short description|Chemical compound}}
{{Drugbox
| IUPAC_name = (1S,3R)-1-[2-(6-amino-9-prop-2-ynylpurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol
| image = ATL-444 Structure.svg
| width = 240
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 867054-13-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y29E2DV2VU
| PubChem = 11616539
| ChemSpiderID = 9791288
| StdInChI = 1S/C17H19N5O/c1-3-9-22-11-19-14-15(18)20-13(21-16(14)22)6-8-17(23)7-4-5-12(2)10-17/h1,11-12,23H,4-5,7,9-10H2,2H3,(H2,18,20,21)/t12-,17-/m1/s1
| StdInChIKey = VEJLEEFUXFQSHP-SJKOYZFVSA-N
| C=17 | H=19 | N=5 | O=1
| smiles = C#CCN1C=NC2=C1N=C(C#C[C@@]3(CCC[C@H](C3)C)O)N=C2N
}}
ATL-444 is a drug which acts as a potent and reasonably selective antagonist for the adenosine receptors A1 and A2A. It has been used to study the role of the adenosine receptor system in the reinforcing action of cocaine,{{cite journal | vauthors = Doyle SE, Breslin FJ, Rieger JM, Beauglehole A, Lynch WJ | title = Time and sex-dependent effects of an adenosine A2A/A1 receptor antagonist on motivation to self-administer cocaine in rats | journal = Pharmacology, Biochemistry, and Behavior | volume = 102 | issue = 2 | pages = 257–63 | date = August 2012 | pmid = 22579716 | pmc = 3383440 | doi = 10.1016/j.pbb.2012.05.001 }} as well as the development of some cancers.{{cite journal | vauthors = Choi MS, Moon SM, Lee SA, Park BR, Kim JS, Kim DK, Kim YH, Kim CS | title = Adenosine induces intrinsic apoptosis via the PI3K/Akt/mTOR signaling pathway in human pharyngeal squamous carcinoma FaDu cells | journal = Oncology Letters | volume = 15 | issue = 5 | pages = 6489–6496 | date = May 2018 | pmid = 29616118 | pmc = 5876434 | doi = 10.3892/ol.2018.8089 }}