AVN-211

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 5,7-dimethyl-2-(methylsulfanyl)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine

| image = AVN-211 Structure.svg

| width = 200px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1173103-84-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L6B63H3RXJ

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 26387125

| ChEMBL = 1668500

| synonyms = CD-008-0173

| C=15 | H=15 | N=3 | O=2 | S=2

| SMILES = Cc1cc(n2c(n1)c(c(n2)SC)S(=O)(=O)c3ccccc3)C

| StdInChI_Ref =

| StdInChIKey_Ref =

| StdInChI = 1S/C15H15N3O2S2/c1-10-9-11(2)18-14(16-10)13(15(17-18)21-3)22(19,20)12-7-5-4-6-8-12/h4-9H,1-3H3

| StdInChIKey = KSAUCBGUWGWPDL-UHFFFAOYSA-N

}}

AVN-211 (CD-008-0173) is a drug which acts as a highly selective 5-HT₆ receptor antagonist and is under development by Avineuro Pharmaceuticals for the treatment of schizophrenia.{{cite book| vauthors = Ellenbroek BA, Cesura AM | chapter = Antipsychotics and the Dopamine-Serotonin Connection| veditors = Celanire S, Poli S |title=Small Molecule Therapeutics for Schizophrenia | chapter-url = https://books.google.com/books?id=HEzPBAAAQBAJ&pg=PA37|date=13 October 2014|publisher=Springer|isbn=978-3-319-11502-3|pages=31, 37}}{{cite book|title=Pharmacology of 5-HT6 receptors|url=https://books.google.com/books?id=1Vn2Qt6dtegC&pg=PA164|date=7 December 2010|publisher=Academic Press|isbn=978-0-12-384977-9|pages=164–}}{{cite journal|title=Drug Development in Schizophrenia: Summary and Table|journal=Pharmaceutical Medicine|volume=28|issue=5|year=2014|pages=265–271|issn=1178-2595|doi=10.1007/s40290-014-0070-6|s2cid=8513976}} In early 2011, it successfully completed phase IIa clinical trials,{{Cite web|url=http://www.avineuro.com/avineuro-pharmaceuticals-inc-reports-positive-phase-2a-clinical-proof-of-concept-trial-results-on-avn-211-potent-small-molecule-for-treatment-of-schizophrenia/|title=Avineuro Pharmaceuticals, Inc. Reports positive Phase 2a clinical proof of concept trial results on AVN-211, potent small molecule for treatment of schizophrenia. | publisher = Avineuro Pharmaceuticals, Inc }} with benefits on positive symptoms and some procognitive effects observed,{{cite journal | vauthors = Morozova MA, Lepilkina TA, Rupchev GE, Beniashvily AG, Burminskiy DS, Potanin SS, Bondarenko EV, Kazey VI, Lavrovsky Y, Ivachtchenko AV | display-authors = 6 | title = Add-on clinical effects of selective antagonist of 5HT6 receptors AVN-211 (CD-008-0173) in patients with schizophrenia stabilized on antipsychotic treatment: pilot study | journal = CNS Spectrums | volume = 19 | issue = 4 | pages = 316–323 | date = August 2014 | pmid = 23768250 | doi = 10.1017/S1092852913000394 | s2cid = 25486838 }} and in mid 2013, phase IIb clinical trials for schizophrenia began.{{Cite web|url=http://www.avineuro.com/avineuro-pharmaceuticals-inc-announces-beginning-of-phase-2b-clinical-studies-of-avn-211-potent-small-molecule-for-treatment-of-schizophrenia/|title = Avineuro Pharmaceuticals, Inc. Announces beginning of Phase 2b clinical studies of AVN-211, potent small molecule for treatment of schizophrenia. | publisher = Avineuro Pharmaceuticals, Inc }} Avineuro Pharmaceuticals also expressed intention to start clinical trials of AVN-211 for Alzheimer's disease in 2015.{{cite journal | vauthors = Ivachtchenko AV, Lavrovsky Y, Ivanenkov YA | title = AVN-211, Novel and Highly Selective 5-HT6 Receptor Small Molecule Antagonist, for the Treatment of Alzheimer's Disease | journal = Molecular Pharmaceutics | volume = 13 | issue = 3 | pages = 945–963 | date = March 2016 | pmid = 26886442 | doi = 10.1021/acs.molpharmaceut.5b00830 }}{{update needed|date=March 2023}}