AXA1125
{{Short description|Experimental drug}}
{{Infobox drug
| drug_name =
| type = combo
| component1 = Leucine
| class1 = Amino acid
| component2 = Isoleucine
| class2 = Amino acid
| component3 = Valine
| class3 = Amino acid
| component4 = Arginine
| class4 = Amino acid
| component5 = Glutamine
| class5 = Amino acid
| component6 = N-Acetylcysteine
| class6 = Amino acid derivative
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration =
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| synonyms = LIVRQNac
| CAS_number =
| PubChem =
| DrugBank =
| KEGG =
| SMILES = N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N(C(=O)C)[C@@]([H])(CS)C(=O)O
}}
AXA1125 is an experimental drug developed by Axcella Health that "increased β-oxidation and improved bioenergetics in preclinical models". It was studied as a treatment for non-alcoholic fatty liver disease and long COVID.{{Cite journal |last=Harrison |first=Stephen A. |last2=Baum |first2=Seth J. |last3=Gunn |first3=Nadege T. |last4=Younes |first4=Ziad H. |last5=Kohli |first5=Anita |last6=Patil |first6=Rashmee |last7=Koziel |first7=Margaret J. |last8=Chera |first8=Harinder |last9=Zhao |first9=Jeff |last10=Chakravarthy |first10=Manu V. |date=December 2021 |title=Safety, Tolerability, and Biologic Activity of AXA1125 and AXA1957 in Subjects With Nonalcoholic Fatty Liver Disease |journal=The American Journal of Gastroenterology |volume=116 |issue=12 |pages=2399–2409 |doi=10.14309/ajg.0000000000001375 |issn=0002-9270 |pmc=8631161 |pmid=34382947 |doi-access=free}}{{Cite journal |last=Finnigan |first=Lucy E.M. |last2=Cassar |first2=Mark Philip |last3=Koziel |first3=Margaret James |last4=Pradines |first4=Joel |last5=Lamlum |first5=Hanan |last6=Azer |first6=Karim |last7=Kirby |first7=Dan |last8=Montgomery |first8=Hugh |last9=Neubauer |first9=Stefan |last10=Valkovič |first10=Ladislav |last11=Raman |first11=Betty |date=May 2023 |title=Efficacy and tolerability of an endogenous metabolic modulator (AXA1125) in fatigue-predominant long COVID: a single-centre, double-blind, randomised controlled phase 2a pilot study |journal=eClinicalMedicine |volume=59 |pages=101946 |doi=10.1016/j.eclinm.2023.101946 |pmc=10102537 |pmid=37223439 |doi-access=free}}Park, Brian. "Orally Active Amino Acid Mixture Fast Tracked for NASH With Liver Fibrosis." Medical Bag, 16 Feb. 2022, p. NA. Gale OneFile: Health and Medicine, link.gale.com/apps/doc/A693790920/HRCA?u=anon~8aede0d3&sid=googleScholar&xid=1e146086. Accessed 3 Dec. 2023.{{Cite news |title=Axcella antes up in key liver diseases with EMM (endogenous metabolic modulator) compositions |url=https://www.nature.com/articles/d43747-020-01135-8 |access-date=3 December 2023 |language=en}}
AXA1125 is a fixed composition comprising five amino acids (leucine, isoleucine, valine, arginine, and glutamine) and an amino acid derivative (N-acetylcysteine).{{Cite journal |last=Daou |first=Nadine |last2=Viader |first2=Andreu |last3=Cokol |first3=Murat |last4=Nitzel |first4=Arianna |last5=Chakravarthy |first5=Manu V. |last6=Afeyan |first6=Raffi |last7=Tramontin |first7=Tony |last8=Marukian |first8=Svetlana |last9=Hamill |first9=Michael J. |date=2021 |title=A novel, multitargeted endogenous metabolic modulator composition impacts metabolism, inflammation, and fibrosis in nonalcoholic steatohepatitis-relevant primary human cell models |journal=Scientific Reports |volume=11 |issue=1 |page=11861 |bibcode=2021NatSR..1111861D |doi=10.1038/s41598-021-88913-1 |pmc=8178416 |pmid=34088912}}