Acenocoumarol
{{Short description|Anticoagulant}}
{{Drugbox
| verifiedrevid = 477238271
| IUPAC_name = (RS)-4-hydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]-2H-chromen-2-one
| image = Acenocoumarol.svg
| width =
| chirality = Racemic mixture
| tradename =
| Drugs.com = {{drugs.com|CONS|acenocoumarol}}
| pregnancy_category = X
| legal_UK = POM
| routes_of_administration = Oral
| bioavailability =
| metabolism = Hepatic
| elimination_half-life = 8 to 11 hours
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 152-72-7
| ATC_prefix = B01
| ATC_suffix = AA07
| PubChem = 9052
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01418
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10443441
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = I6WP63U32H
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07064
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 53766
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 397420
| C=19 | H=15 | N=1 | O=6
| smiles = CC(=O)CC(C1=CC=C(C=C1)[N+](=O)[O-])C2=C(OC3=CC=CC=C3C2=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H15NO6/c1-11(21)10-15(12-6-8-13(9-7-12)20(24)25)17-18(22)14-4-2-3-5-16(14)26-19(17)23/h2-9,15,22H,10H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VABCILAOYCMVPS-UHFFFAOYSA-N
| melting_point = 196
| melting_high = 199
}}
Acenocoumarol is an anticoagulant that functions as a vitamin K antagonist (like warfarin). It is a derivative of coumarin and is generic, so is marketed under many brand names worldwide.{{cite web | url = https://www.drugs.com/international/acenocoumarol.html | work = Drugs.com | title = International listings for acenocoumarol }}
References
{{Reflist}}
Further reading
{{refbegin}}
- {{cite journal | vauthors = Cesar JM, García-Avello A, Navarro JL, Herraez MV | title = Aging and oral anticoagulant therapy using acenocoumarol | journal = Blood Coagulation & Fibrinolysis | volume = 15 | issue = 8 | pages = 673–676 | date = October 2004 | pmid = 15613922 | doi = 10.1097/00001721-200412000-00007 | s2cid = 19214006 }}
- {{cite journal | vauthors = Lengyel M | title = [Warfarin or acenocoumarol is better in the anticoagulant treatment of chronic atrial fibrillation?] | journal = Orvosi Hetilap | volume = 145 | issue = 52 | pages = 2619–2621 | date = December 2004 | pmid = 15724697 }}
- {{cite journal | vauthors = Ufer M | title = Comparative pharmacokinetics of vitamin K antagonists: warfarin, phenprocoumon and acenocoumarol | journal = Clinical Pharmacokinetics | volume = 44 | issue = 12 | pages = 1227–1246 | year = 2005 | pmid = 16372822 | doi = 10.2165/00003088-200544120-00003 | s2cid = 42970169 }}
- {{cite journal | vauthors = Montes R, Ruiz de Gaona E, Martínez-González MA, Alberca I, Hermida J | title = The c.-1639G > A polymorphism of the VKORC1 gene is a major determinant of the response to acenocoumarol in anticoagulated patients | journal = British Journal of Haematology | volume = 133 | issue = 2 | pages = 183–187 | date = April 2006 | pmid = 16611310 | doi = 10.1111/j.1365-2141.2006.06007.x | hdl-access = free | s2cid = 369821 | hdl = 10171/21989 }}
{{refend}}
External links
- {{DiseasesDB|29202}}
{{Antithrombotics}}
{{coumarin}}
Category:Vitamin K antagonists
Category:4-Nitrophenyl compounds
Category:Anticoagulant rodenticides
{{Blood-drug-stub}}