Acetarsol

{{cs1 config|name-list-style=vanc}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477238724

| ImageFile = Acetarsol.svg

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageSize = 244

| ImageName = Kekulé, skeletal formula of acetarsol

| PIN = (3-Acetamido-4-hydroxyphenyl)arsonic acid

| OtherNames = Acetarsone

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 97-44-9

| ChEBI = 135135

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1330792

| DrugBank = DB13268

| PubChem = 1985

| ChemSpiderID = 1908

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| UNII = 806529YU1N

| UNII_Ref = {{fdacite|correct|FDA}}

| EINECS = 202-582-3

| UNNumber = 3465

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07110

| MeSHName = Acetarsol

| SMILES = CC(=O)Nc1cc(ccc1O)[As](O)(O)=O

| SMILES1 = CC(=O)NC1=CC(=CC=C1O)[As](O)(O)=O

| StdInChI = 1S/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| InChI = 1/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)

| StdInChIKey = ODFJOVXVLFUVNQ-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| InChIKey = ODFJOVXVLFUVNQ-UHFFFAOYAX}}

|Section2={{Chembox Properties

| C=8|As=1|N=1|H=10|O=5

| MolarMass = 275.0903 g mol⁻¹

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = A07

| ATCCode_suffix = AX02

| ATC_Supplemental = {{ATC|G01|AB01}}, {{ATC|P01|CD02}}, {{ATC|P51|AD05}}

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS skull and crossbones}} {{GHS environment}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|301|331|410}}

| PPhrases = {{P-phrases|261|273|301+310|311|501}}

}}

}}

Acetarsol (or acetarsone{{cite web|url=https://fdasis.nlm.nih.gov/srs/unii/806529YU1N|title=FDA Substance Registration System: Acetarsol|accessdate=6 May 2021|archive-date=8 January 2021|archive-url=https://web.archive.org/web/20210108134948/https://fdasis.nlm.nih.gov/srs/unii/806529yu1n|url-status=dead}}) is an anti-infective drug.{{cite journal |vauthors=Chen MY, Smith NA, Fox EF, Bingham JS, Barlow D |title=Acetarsol pessaries in the treatment of metronidazole resistant Trichomonas vaginalis |journal=Int J STD AIDS |volume=10 |issue=4 |pages=277–80 |date=April 1999 |pmid=12035784 |doi= 10.1258/0956462991913943|s2cid=27353282 |url=http://ijsa.rsmjournals.com/cgi/pmidlookup?view=long&pmid=12035784|url-access=subscription }}

It was first discovered in 1921 at Pasteur Institute by Ernest Fourneau,{{cite web|last=PubChem|title=Acetarsol|url=https://pubchem.ncbi.nlm.nih.gov/compound/1985|access-date=2021-03-31|website=pubchem.ncbi.nlm.nih.gov|language=en}} and sold under the brand name Stovarsol.{{cite web |url=http://www.ordre.pharmacien.fr/upload/Syntheses/161.pdf |title=Éric Fouassier, Ces poisons qui guérissent, oct. 1996, p. 5. |access-date=2010-04-01 |archive-date=2011-10-05 |archive-url=https://web.archive.org/web/20111005185843/http://www.ordre.pharmacien.fr/upload/Syntheses/161.pdf |url-status=dead }}Traité de chimie organique, sous la direction de Victor Grignard, Paul Baud, vol. 22, Masson, 1959, p. 1127-1130. It has been given in the form of suppositories.{{cite journal |vauthors=Gionchetti P, Rizzello F, Morselli C, Campieri M |title=Review article: problematic proctitis and distal colitis |journal=Aliment. Pharmacol. Ther. |volume=20 |pages=93–6 |date=October 2004 |issue=Suppl 4 |pmid=15352902 |doi=10.1111/j.1365-2036.2004.02049.x |s2cid=72699260 |doi-access=free }}

Acetarsol can be used to make arsthinol.{{cn|date=December 2022}}

It has been cancelled and withdrawn from the market since August 12th, 1997.