Acetozone

{{Chembox

| ImageFile = Acetozone.svg

| ImageSize = 200px

| PIN = Acetic benzoic peroxyanhydride

| OtherNames = Acetyl benzoyl peroxide; Benzoyl acetyl peroxide; Benzozone; Acetyl benzenecarboperoxoate

| Section1 = {{Chembox Identifiers

| CASNo = 644-31-5

| PubChem = 12568

| ChemSpiderID = 12048

| EINECS = 211-412-7

| UNII = 5AA81KS1U5

| SMILES = CC(=O)OOC(=O)c1ccccc1

| StdInChI=1S/C9H8O4/c1-7(10)12-13-9(11)8-5-3-2-4-6-8/h2-6H,1H3

| StdInChIKey=PDAVOLCVHOKLEO-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=9|H=8|O=4

| Appearance = White crystalline solid{{cite web | url = https://en.oxforddictionaries.com/definition/acetozone | archive-url = https://web.archive.org/web/20180224052908/https://en.oxforddictionaries.com/definition/acetozone | url-status = dead | archive-date = February 24, 2018 | publisher = Oxford Dictionaries | title = Acetozone}}

| Density =

| MeltingPtC = 36-37

| MeltingPt_ref = {{cite book | title = Merck Index | edition = 12th | page = 15 | id = 78 | title-link = Merck Index }}

| BoilingPtC = 130

| BoilingPt_notes= (19 mmHg)

| BoilingPt_ref =

| Solubility = Soluble in carbon tetrachloride, chloroform, ether, and oils

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Acetozone is an organic peroxide that is a strong oxidant.

In the early 20th century, it found use as a surgical antiseptic{{Cite journal | pmid = 20768694| pmc = 2355305| year = 1917| last1 = Gore-Gillon| first1 = G| title = Acetozone As a General Surgical Antiseptic| journal = British Medical Journal| volume = 2| issue = 2955| pages = 209–10| last2 = Hewlett| first2 = R. T| doi=10.1136/bmj.2.2955.209}} and for the treatment of typhoid fever.{{Cite journal | doi = 10.1001/jama.1906.25210200047002| title = Acetozone in Typhoid Fever| journal = JAMA: The Journal of the American Medical Association| issue = 20| pages = 1651| year = 1906| last1 = Humiston| first1 = RAY| url = https://zenodo.org/record/1423362}}

It has also been used as a bleaching agent for flour.{{cite web | url = http://www.nj.gov/health/eoh/rtkweb/documents/fs/0011.pdf | title= Acetyl benzoyl peroxide | work = Hazardous Substance Fact Sheets | publisher = New Jersey Department of Health and Senior Services}}