Acifran

{{Chembox

| Name =

| ImageFile = acifran.svg

| ImageSize = 150px

| IUPACName = 5-Methyl-4-oxo-5-phenyl-4,5-dihydro-2-furancarboxylic acid

| SystematicName = 5-Methyl-4-oxo-5-phenyl-4,5-dihydro-2-furancarboxylic acid

| OtherNames =

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 1595

| Abbreviations =

| CASNo = 72420-38-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = B1X701S0MV

| EINECS =

| PubChem = 51576

| ChemSpiderID = 46712

| ChEMBL = 278488

| SMILES = CC1(C(=O)C=C(O1)C(=O)O)C2=CC=CC=C2

| InChI = 1/C12H10O4/c1-12(8-5-3-2-4-6-8)10(13)7-9(16-12)11(14)15/h2-7H,1H3,(H,14,15)

| InChIKey = DFDGRKNOFOJBAJ-UHFFFAOYAE

| StdInChI = 1S/C12H10O4/c1-12(8-5-3-2-4-6-8)10(13)7-9(16-12)11(14)15/h2-7H,1H3,(H,14,15)

| StdInChIKey = DFDGRKNOFOJBAJ-UHFFFAOYSA-N

| RTECS =

| MeSHName =

| ChEBI =

| KEGG = D02753

}}

|Section2={{Chembox Properties

| C=12 | H=10 | O=4

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| PregCat =

| PregCat_AU =

| PregCat_US =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Acifran is a niacin receptor agonist.{{cite journal | pmid = 17358052 | title = Analogues of acifran: agonists of the high and low affinity niacin receptors, GPR109a and GPR109b | doi=10.1021/jm070022x | volume=50 | issue=7 | date=April 2007 | journal=J. Med. Chem. | pages=1445–8| last1 = Jung | first1 = J. K. | last2 = Johnson | first2 = B. R. | last3 = Duong | first3 = T | last4 = Decaire | first4 = M | last5 = Uy | first5 = J | last6 = Gharbaoui | first6 = T | last7 = Boatman | first7 = P. D. | last8 = Sage | first8 = C. R. | last9 = Chen | first9 = R | last10 = Richman | first10 = J. G. | last11 = Connolly | first11 = D. T. | last12 = Semple | first12 = G }}

References